CAS 66781-75-7
:3-O-[2-(acetylamino)-2-deoxy-alpha-D-galactopyranosyl]-D-galactose
Description:
3-O-[2-(Acetylamino)-2-deoxy-alpha-D-galactopyranosyl]-D-galactose is a glycosylated compound characterized by its structural complexity, featuring a galactose moiety linked to a 2-deoxy-2-acetamido-D-galactopyranosyl unit. This compound is notable for its potential biological activity, particularly in the context of cell recognition and signaling processes, as it may interact with specific receptors or proteins due to its carbohydrate nature. The presence of the acetylamino group enhances its solubility and may influence its reactivity and stability. In terms of physical properties, it is typically a white to off-white solid, soluble in water and polar solvents, and may exhibit hygroscopic behavior. Its applications can span various fields, including biochemistry and pharmaceuticals, where it may serve as a building block for more complex glycosylated structures or as a probe in glycan-related studies. Understanding its characteristics is essential for exploring its potential roles in biological systems and therapeutic applications.
Formula:C14H25NO11
InChI:InChI=1/C14H25NO11/c1-5(19)15-9-12(24)11(23)8(4-18)25-14(9)26-13(7(21)3-17)10(22)6(20)2-16/h3,6-14,16,18,20-24H,2,4H2,1H3,(H,15,19)/t6-,7+,8-,9-,10+,11+,12-,13-,14-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-O-(2-Acetamido-2-deoxy-a-D-galactopyranosyl)-D-galactopyranose
CAS:3-O-(2-Acetamido-2-deoxy-a-D-galactopyranosyl)-D-galactopyranose is an endothelial cell growth factor that is generated by the enzymatic activity of galactosyltransferase. It binds to lectin, glycan, and monoclonal antibodies. This molecule has been shown to have biological properties that are related to cancer and immunology. 3-O-(2-Acetamido-2-deoxy-a-D-galactopyranosyl)-D-galactopyranose may be used as a glycolipid marker in blood group typing and in the detection of cervical cancer cells.Formula:C14H25NO11Purity:Min. 95%Color and Shape:White PowderMolecular weight:383.33 g/mol
