CAS 668-49-5
:Murideoxycholic acid
Description:
Murideoxycholic acid, with the CAS number 668-49-5, is a bile acid that plays a significant role in the digestion and absorption of fats in the intestine. It is a derivative of deoxycholic acid and is characterized by its steroid structure, which includes a hydroxyl group that contributes to its amphipathic nature, allowing it to interact with both lipophilic and hydrophilic substances. This property is crucial for its function as a detergent in emulsifying dietary fats. Murideoxycholic acid is primarily found in the bile of certain animals, particularly rodents, and is involved in various physiological processes, including cholesterol metabolism and the regulation of lipid homeostasis. Its biological activity is influenced by its ability to interact with specific receptors, such as the farnesoid X receptor (FXR), which plays a role in metabolic regulation. Additionally, murideoxycholic acid has been studied for its potential therapeutic applications, particularly in the context of liver diseases and metabolic disorders.
Formula:C24H40O4
InChI:InChI=1S/C24H40O4/c1-14(4-7-22(27)28)17-5-6-18-16-13-21(26)20-12-15(25)8-10-24(20,3)19(16)9-11-23(17,18)2/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16+,17-,18+,19+,20+,21-,23-,24-/m1/s1
InChI key:InChIKey=DGABKXLVXPYZII-PLYQRAMGSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H](CCC(O)=O)C)(CC4)[H])[H])(C[C@@H](O)[C@@]1(C[C@H](O)CC2)[H])[H])[H]
Synonyms:- (3α,5β,6β)-3,6-Dihydroxycholan-24-oic acid
- 3a,6b-Dihydroxy-5b-cholan-24-oic acid
- 3α,6β-Dihydroxy-5β-cholanic acid
- 3α,6β-Dihydroxy-5β-cholanoic acid
- 3α,6β-Dihydroxycholanoic acid
- 5β-Cholan-24-oic acid, 3α,6β-dihydroxy-
- 5β-Cholanic acid, 3α,6β-dihydroxy-
- 668-49-5
- 6β-Hydroxylithocholic acid
- Cholan-24-oic acid, 3,6-dihydroxy-, (3.alpha.,5.beta.,6.beta.)-
- Cholan-24-oic acid, 3,6-dihydroxy-, (3α,5β,6β)-
- Murideoxycholic acid
- Murocholic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Murideoxycholic Acid
CAS:MDCA, a secondary bile acid, prevents gallstone formation but doesn't dissolve them; has a 3.5-day half-life in humans.Formula:C24H40O4Purity:95%Color and Shape:SolidMolecular weight:392.575b-Cholanic Acid-3a,6b-diol
CAS:Controlled Product<p>Applications 5β-Cholanic Acid-3α, 6β-Diol is a cholesterol derivative; Plasma lipophilic biomarkers in rats. Also, it is one of two major metabolites from the hydroxylation of hepatic lithocholic acid catalyzed by Cyp3a/Cyp3a11 enzymes in mice.<br>References Mayengbam, S., et al.: Eur. J. Nutr., 55, 1213-1223 (2016); Hrycay, E., et al.: Mol. Cell. Biochem., 389, 119-132 (2014)<br></p>Formula:C24H40O4Color and Shape:White To Off-WhiteMolecular weight:392.58Murideoxycholic acid
CAS:Controlled Product<p>Murideoxycholic acid is a bile acid that is used in combination with other antibiotics to treat infections caused by bacteria. Murideoxycholic acid inhibits the bacterial transport of bile acids, which are important for the digestion of fats and proteins. Murideoxycholic acid binds to the cytochrome P450 enzyme in humans and rats, inhibiting its activity. This binding prevents the production of bile acids from cholesterol in the liver, which prevents their normal excretion into the intestine and leads to an increased risk for gallstones. Murideoxycholic acid also has been shown to inhibit human CYP3A4 enzyme activity. The hydroxyl group on this molecule reacts with ferrous ions to produce hydroxyl radicals, which can lead to oxidative stress and lipid peroxidation.</p>Formula:C24H40O4Purity:Min. 95%Molecular weight:392.57 g/mol




