CAS 668-94-0
:4,5-Diphenylimidazole
Description:
4,5-Diphenylimidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features two phenyl groups attached to the 4 and 5 positions of the imidazole ring, contributing to its unique properties. It is typically a white to light yellow crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. 4,5-Diphenylimidazole is known for its potential applications in various fields, including pharmaceuticals, where it may serve as a building block for drug synthesis or as a ligand in coordination chemistry. Its chemical stability and ability to participate in various chemical reactions make it a valuable compound in research and industrial applications. Additionally, the presence of the phenyl groups can influence its electronic properties, making it of interest in materials science and organic electronics. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C15H12N2
InChI:InChI=1S/C15H12N2/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17)
InChI key:InChIKey=CPHGOBGXZQKCKI-UHFFFAOYSA-N
SMILES:C1(=C(N=CN1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 1H-Imidazole, 4,5-diphenyl-
- 1H-Imidazole, 4,5-diphenyl- (9CI)
- 4,5-Diphenyl-1H-imidazole
- Imidazole, 4,5-diphenyl-
- Imidazole, 4,5-diphenyl- (8CI)
- Nsc 59776
- 4,5-Diphenylimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4,5-Diphenylimidazole
CAS:Formula:C15H12N2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:220.284,5-Diphenyl-4H-imidazole
CAS:Formula:C15H12N2Purity:98%Color and Shape:SolidMolecular weight:220.26924,5-Diphenylimidazole
CAS:4,5-Diphenylimidazole is an antimicrobial agent that binds to the bacterial cell wall and inhibits the synthesis of polysaccharides. This drug has been shown to be effective against a variety of bacteria including Gram-positive bacteria such as Staphylococcus aureus, Streptococcus pyogenes, and Enterococcus faecalis. 4,5-Diphenylimidazole has been tested in clinical studies for the treatment of allergic symptoms caused by antibiotic drugs such as penicillin. It works by binding to the trifluoromethyl group and reacting with metal ions to form metal chelates. The antibacterial properties are due to the formation of reactive oxygen species that lead to oxidative stress in bacterial cells.Formula:C15H12N2Purity:Min. 95%Molecular weight:220.27 g/mol





