CymitQuimica logo

CAS 66810-01-3

:

1,3-Propanediol, 2-(4-bromophenyl)-2-methyl-

Description:
1,3-Propanediol, 2-(4-bromophenyl)-2-methyl- is an organic compound characterized by its structure, which includes a propane backbone with hydroxyl groups and a bromophenyl substituent. This compound typically features two hydroxyl (-OH) groups, making it a diol, which contributes to its solubility in polar solvents and its potential reactivity in various chemical reactions. The presence of the bromophenyl group introduces both steric and electronic effects, which can influence the compound's reactivity and interaction with other molecules. It may exhibit properties such as moderate volatility and stability under standard conditions, but specific characteristics like melting point, boiling point, and density would depend on the molecular interactions and the presence of functional groups. Additionally, the bromine atom can impart unique properties, such as increased lipophilicity and potential for electrophilic substitution reactions. This compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C10H13BrO2
InChI:InChI=1S/C10H13BrO2/c1-10(6-12,7-13)8-2-4-9(11)5-3-8/h2-5,12-13H,6-7H2,1H3
InChI key:XDJSHHGIWNDIOH-UHFFFAOYSA-N
SMILES:CC(CO)(CO)C1=CC=C(C=C1)Br
Found 4 products.