
CAS 66813-29-4
:2-[(6-Amino-9H-purin-8-yl)amino]ethanol
Description:
2-[(6-Amino-9H-purin-8-yl)amino]ethanol, also known by its CAS number 66813-29-4, is a chemical compound that features a purine base structure, specifically derived from adenine. This substance is characterized by the presence of an amino group and an ethanol moiety, which contribute to its biological activity. It is typically a white to off-white solid and is soluble in water due to the hydroxyl group in its structure. The compound is of interest in biochemical research, particularly in studies related to nucleic acids and cellular processes, as it may play a role in nucleotide metabolism or serve as a building block in the synthesis of nucleosides. Its molecular structure allows for hydrogen bonding, which can influence its interactions with other biomolecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C7H10N6O
InChI:InChI=1S/C7H10N6O/c8-5-4-6(11-3-10-5)13-7(12-4)9-1-2-14/h3,14H,1-2H2,(H4,8,9,10,11,12,13)
InChI key:InChIKey=CRWIVQWPUFWSCJ-UHFFFAOYSA-N
SMILES:NC1=C2C(N=C(NCCO)N2)=NC=N1
Synonyms:- Ethaden
- 2-[(6-Amino-9H-purin-8-yl)amino]ethan-1-ol
- Ethanol, 2-[(6-amino-9H-purin-8-yl)amino]-
- 2-[(6-Amino-9H-purin-8-yl)amino]ethanol
- Ethanol, 2-[(6-amino-1H-purin-8-yl)amino]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-[(6-Amino-1H-purin-8-yl)amino]ethan-1-ol
CAS:<p>2-[(6-Amino-1H-purin-8-yl)amino]ethan-1-ol (6APA) is a prodrug that is metabolized by the liver to 6-mercaptopurine (6MP). It is an antiinflammatory drug that has been shown to suppress collagen synthesis and inhibit the activity of proteases. 6APA is also used as a diagnostic agent for systemic diseases, such as reactive arthritis and systemic lupus erythematosus. This compound can be used in the treatment of inflammatory diseases, such as rheumatoid arthritis and Crohn's disease, due to its ability to inhibit the production of inflammatory compounds. The drug binds to affinity ligands which are associated with various proteins, including collagen. This binding prevents the formation of new proteins, which leads to cell death by inhibiting protein synthesis.</p>Formula:C7H10N6OPurity:Min. 95%Molecular weight:194.19 g/mol
