CAS 66818-22-2
:Naphtho[1,2-c:5,6-c′]dipyrazole, 2,3b,4,5,7,8b,9,10-octahydro-, trans-
Description:
Naphtho[1,2-c:5,6-c′]dipyrazole, 2,3b,4,5,7,8b,9,10-octahydro-, trans- (CAS 66818-22-2) is a polycyclic compound characterized by its fused naphthalene and pyrazole rings. This compound features a unique bicyclic structure that contributes to its chemical stability and potential reactivity. It is typically a solid at room temperature and may exhibit various physical properties such as solubility in organic solvents, depending on its specific functional groups and substituents. The presence of multiple nitrogen atoms in the pyrazole rings can impart interesting electronic properties, making it a candidate for applications in materials science and medicinal chemistry. Additionally, the trans configuration suggests specific stereochemical properties that may influence its biological activity and interactions with other molecules. Overall, this compound's structural complexity and unique characteristics make it a subject of interest in various fields of research, including organic synthesis and drug development.
Formula:C12H14N4
InChI:InChI=1/C12H14N4/c1-3-9-10(11-7(1)5-13-15-11)4-2-8-6-14-16-12(8)9/h5-6,9-10H,1-4H2,(H,13,15)(H,14,16)/t9-,10+
InChI key:InChIKey=RTMZVYUACSCNRL-AOOOYVTPNA-N
SMILES:[C@]12([C@](C=3C(CC1)=CNN3)(CCC=4C2=NNC4)[H])[H]
Synonyms:- Naphtho[1,2-c:5,6-c′]dipyrazole, 2,3b,4,5,7,8b,9,10-octahydro-, trans-
- LC 6
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
LC 6
CAS:LC 6 is an orally active antiallergic agent.Formula:C12H14N4Color and Shape:SolidMolecular weight:214.27
