CAS 66820-64-2

2-Bromo-3,4,5,6-tetrafluorobenzotrifluoride

Description:

2-Bromo-3,4,5,6-tetrafluorobenzotrifluoride, with the CAS number 66820-64-2, is a halogenated aromatic compound characterized by the presence of both bromine and multiple fluorine substituents on a benzene ring. This compound features a bromine atom at the second position and three fluorine atoms at the 3, 4, 5, and 6 positions of the benzene ring, along with a trifluoromethyl group (-CF3) attached to the aromatic system. The presence of these electronegative halogens significantly influences its chemical properties, including increased stability and reactivity in certain reactions. It is typically a colorless to pale yellow liquid or solid, depending on the temperature, and exhibits low volatility. Due to its halogenated nature, it may have applications in various fields, including organic synthesis, materials science, and as a potential intermediate in the production of pharmaceuticals or agrochemicals. However, handling requires caution due to potential toxicity and environmental concerns associated with halogenated compounds.

Formula: C₇BrF₇

InChI: InChI=1/C7BrF7/c8-2-1(7(13,14)15)3(9)5(11)6(12)4(2)10

SMILES: c1(c(c(c(c(c1F)F)F)F)Br)C(F)(F)F

Synonyms:

• 1-Bromo-2,3,4,5-Tetrafluoro-6-(Trifluoromethyl)Benzene

2-Bromo-3,4,5,6-tetrafluorobenzotrifluoride

CAS: 66820-64-2

2-Bromo-3,4,5,6-tetrafluorobenzotrifluoride

Purity: 95%

Molecular weight: 296.97g/mol

Ref: 54-PC520570