CAS 668268-69-7

7-Chloro-1H-imidazo[4,5-c]pyridin-4-amine

Description:

7-Chloro-1H-imidazo[4,5-c]pyridin-4-amine is a heterocyclic organic compound characterized by its imidazo and pyridine rings, which contribute to its unique chemical properties. This compound features a chlorine atom at the 7-position of the imidazo ring and an amino group at the 4-position of the pyridine ring, influencing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry, particularly for its potential as a pharmacological agent, as the imidazo and pyridine moieties are often found in biologically active compounds. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₅ClN₄

InChI: InChI=1S/C6H5ClN4/c7-3-1-9-6(8)5-4(3)10-2-11-5/h1-2H,(H2,8,9)(H,10,11)

InChI key: InChIKey=JNVAYRKQQLXCQL-UHFFFAOYSA-N

SMILES: ClC1=C2C(=C(N)N=C1)N=CN2

Synonyms:

• 1H-Imidazo[4,5-c]pyridin-4-amine, 7-chloro-
• 7-Chloro-1H-imidazo[4,5-c]pyridin-4-amine

1H-Imidazo[4,5-c]pyridin-4-amine, 7-chloro-

CAS: 668268-69-7

Formula: C₆H₅ClN₄

Purity: 95%

Molecular weight: 168.5837

Ref: IN-DA00FH48

7-Chloro-1H-imidazo[4,5-c]pyridin-4-amine

CAS: 668268-69-7

Formula: C₆H₅ClN₄

Purity: 95.0%

Molecular weight: 168.58

Ref: 10-F465143