CAS 66827-38-1

cyano(4-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate

Description:

Cyano(4-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate, with the CAS number 66827-38-1, is an organic compound characterized by its complex structure, which includes a cyano group, a phenoxyphenyl moiety, and a butanoate ester functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the cyano group suggests potential reactivity, particularly in nucleophilic addition reactions, while the ester functionality may influence solubility and reactivity in biological systems. The chlorophenyl group can enhance the compound's lipophilicity, potentially affecting its bioavailability and interaction with biological targets. Overall, the unique combination of functional groups in this compound may impart specific chemical and physical properties, making it of interest for further research and development in synthetic chemistry and material science.

Formula: C₂₅H₂₂ClNO₃

InChI: InChI=1/C25H22ClNO3/c1-17(2)24(19-8-12-20(26)13-9-19)25(28)30-23(16-27)18-10-14-22(15-11-18)29-21-6-4-3-5-7-21/h3-15,17,23-24H,1-2H3

SMILES: CC(C)C(c1ccc(cc1)Cl)C(=O)OC(C#N)c1ccc(cc1)Oc1ccccc1

Cyano(4-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate

Controlled Product

CAS: 66827-38-1

Applications Cyano(4-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate isi a useful chemical reagent.

Formula: C₂₅H₂₂ClNO₃

Color and Shape: Neat

Molecular weight: 419.9

Ref: TR-C990155