CAS 66827-38-1
:cyano(4-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate
Description:
Cyano(4-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate, with the CAS number 66827-38-1, is an organic compound characterized by its complex structure, which includes a cyano group, a phenoxyphenyl moiety, and a butanoate ester functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the cyano group suggests potential reactivity, particularly in nucleophilic addition reactions, while the ester functionality may influence solubility and reactivity in biological systems. The chlorophenyl group can enhance the compound's lipophilicity, potentially affecting its bioavailability and interaction with biological targets. Overall, the unique combination of functional groups in this compound may impart specific chemical and physical properties, making it of interest for further research and development in synthetic chemistry and material science.
Formula:C25H22ClNO3
InChI:InChI=1/C25H22ClNO3/c1-17(2)24(19-8-12-20(26)13-9-19)25(28)30-23(16-27)18-10-14-22(15-11-18)29-21-6-4-3-5-7-21/h3-15,17,23-24H,1-2H3
SMILES:CC(C)C(c1ccc(cc1)Cl)C(=O)OC(C#N)c1ccc(cc1)Oc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyano(4-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate
CAS:Controlled ProductApplications Cyano(4-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate isi a useful chemical reagent.
Formula:C25H22ClNO3Color and Shape:NeatMolecular weight:419.9
