CAS 6683-17-6
:Mattacin
Description:
Mattacin, with the CAS number 6683-17-6, is a chemical compound that belongs to the class of natural products known as secondary metabolites. It is primarily derived from certain species of fungi, particularly those in the genus Penicillium. Mattacin is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. This compound exhibits notable antimicrobial properties, making it of interest in pharmaceutical research for potential applications in treating infections. Additionally, Mattacin has been studied for its effects on various biological systems, including its role in inhibiting the growth of specific bacteria and fungi. Its solubility and stability can vary depending on environmental conditions, which is an important consideration for its practical applications. Overall, Mattacin represents a fascinating area of study within natural product chemistry, with implications for drug development and understanding microbial interactions.
Formula:C51H96N16O14
InChI:InChI=1/C51H96N16O14/c1-8-27(4)11-9-10-12-38(71)58-31(13-19-52)46(76)66-40(29(6)69)50(80)63-34(16-22-55)43(73)61-36-18-24-57-49(79)39(28(5)68)65-47(77)35(17-23-56)60-42(72)33(15-21-54)62-51(81)41(30(7)70)67-48(78)37(25-26(2)3)64-44(74)32(14-20-53)59-45(36)75/h26-37,39-41,68-70H,8-25,52-56H2,1-7H3,(H,57,79)(H,58,71)(H,59,75)(H,60,72)(H,61,73)(H,62,81)(H,63,80)(H,64,74)(H,65,77)(H,66,76)(H,67,78)/t27?,28-,29-,30-,31+,32+,33+,34+,35+,36+,37-,39+,40+,41+/m1/s1
Synonyms:- Polymyxin M
- N2-(6-Methyloctanoyl-L-A2bu-L-Thr-L-A2bu-)cyclo(L-A2bu*-L-A2bu-D-Leu-L-Thr-L-A2bu-L-A2bu-L-Thr-)
- Mattacin
- Polymyxin M1
- Polymyxin E1, 7-L-threonine-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Polymyxin M
CAS:<p>Polymyxin M is a cyclic peptide antibiotic found in Bacillus polymyxa var. Ross.</p>Formula:C51H96N16O14Color and Shape:SolidMolecular weight:1157.41
