CAS 66838-69-5

2-(1H-benzimidazol-2-yl)-1-phenylethanone

Description:

2-(1H-benzimidazol-2-yl)-1-phenylethanone, with the CAS number 66838-69-5, is an organic compound characterized by its unique structural features, which include a benzimidazole moiety and a phenyl group attached to an ethanone backbone. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals and organic synthesis due to its bioactive properties. The presence of the benzimidazole ring often imparts significant biological activity, making it of interest in medicinal chemistry. Additionally, the compound may display moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as light and temperature. Its reactivity can be attributed to the functional groups present, allowing for various chemical transformations. Overall, 2-(1H-benzimidazol-2-yl)-1-phenylethanone serves as a valuable compound in research and development, particularly in the fields of drug discovery and material science.

Formula: C₁₅H₁₂N₂O

InChI: InChI=1/C15H12N2O/c18-14(11-6-2-1-3-7-11)10-15-16-12-8-4-5-9-13(12)17-15/h1-9H,10H2,(H,16,17)

SMILES: c1ccc(cc1)C(=O)Cc1nc2ccccc2[nH]1

Synonyms:

• ethanone, 2-(1H-benzimidazol-2-yl)-1-phenyl-
• 2-(1H-Benzimidazol-2-yl)-1-phenylethanone

2-(1H-1,3-Benzodiazol-2-yl)-1-phenylethan-1-one

CAS: 66838-69-5

2-(1H-1,3-Benzodiazol-2-yl)-1-phenylethanone is an unsymmetrical phenacyl chloride that is used in the synthesis of drugs. The generation of acidolysis products and the formation of active methylene compounds are catalyzed by 2-(1H-1,3-benzodiazol-2-yl)-1-phenylethanone. This compound is also used for the preparation of chlorides and methylhydrazones. Preparative methods for this compound involve thionyl chloride, hydrochloric acid, and phenylhydrazone.

Formula: C₁₅H₁₂N₂O

Purity: Min. 95%

Molecular weight: 236.27 g/mol

Ref: 3D-RCA83869