CAS 66839-66-5
:(lys3)-bombesin
Description:
Lys3-bombesin, identified by its CAS number 66839-66-5, is a synthetic peptide that is a derivative of the naturally occurring bombesin, a neuropeptide originally isolated from the skin of the European fire-bellied toad. This peptide consists of a sequence of amino acids that includes lysine at the third position, which enhances its biological activity and stability. Lys3-bombesin exhibits high affinity for bombesin receptors, which are involved in various physiological processes, including the regulation of gastric secretion, stimulation of smooth muscle contraction, and modulation of neuroendocrine functions. Due to its receptor-targeting properties, it has been studied for potential applications in cancer diagnosis and therapy, particularly in targeting tumors that express bombesin receptors. Additionally, its structural characteristics allow for modifications that can improve its pharmacokinetic properties, making it a subject of interest in peptide-based drug development. Overall, lys3-bombesin represents a significant molecule in the field of medicinal chemistry and peptide research.
Formula:C71H110N22O18S
InChI:InChI=1/C71H110N22O18S/c1-8-13-44(62(102)79-33-58(98)84-52(29-40-32-77-35-81-40)70(110)92-50(27-37(4)5)69(109)86-43(60(76)100)23-25-112-7)87-61(101)38(6)82-68(108)51(28-39-31-78-42-15-10-9-14-41(39)42)93-67(107)48(18-21-55(74)95)90-71(111)53(30-56(75)96)85-59(99)34-80-63(103)49(26-36(2)3)91-64(104)45(16-11-12-24-72)88-66(106)47(17-20-54(73)94)89-65(105)46-19-22-57(97)83-46/h9-10,14-15,31-32,35-38,43-53,78H,8,11-13,16-30,33-34,72H2,1-7H3,(H2,73,94)(H2,74,95)(H2,75,96)(H2,76,100)(H,77,81)(H,79,102)(H,80,103)(H,82,108)(H,83,97)(H,84,98)(H,85,99)(H,86,109)(H,87,101)(H,88,106)(H,89,105)(H,90,111)(H,91,104)(H,92,110)(H,93,107)/t38?,43-,44-,45-,46-,47-,48-,49-,50?,51-,52?,53-/m0/s1
SMILES:CCC[C@@H](C(=NCC(=NC(Cc1cnc[nH]1)C(=NC(CC(C)C)C(=N[C@@H](CCSC)C(=N)O)O)O)O)O)N=C(C(C)N=C([C@H](Cc1c[nH]c2ccccc12)N=C([C@H](CCC(=N)O)N=C([C@H](CC(=N)O)N=C(CN=C([C@H](CC(C)C)N=C([C@H](CCCCN)N=C([C@H](CCC(=N)O)N=C([C@@H]1CCC(=N1)O)O)O)O)O)O)O)O)O)O
Synonyms:- Pyr-Gln-Lys-Leu-Gly-Asn-Gln-Trp-Ala-Val-Gly-His-Leu-Met-NH2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
[Lys<sup>3</sup>] Bombesin
CAS:<p>For cellular and molecular biology applications</p>Formula:C71H110N22O18SMolecular weight:1591.83(Lys3)-Bombesin
CAS:<p>Lys3-Bombesin is a bifunctional peptide that binds to the bombesin receptor and is used in cancer therapy. It is a radiotracer, which can be used for diagnostic imaging and diagnosis of tumors. Lys3-Bombesin has a high affinity for the bombesin receptor subtype B, which is expressed by prostate cancer cells. The peptide can be conjugated to a small molecule, such as a radioactive isotope, and used to deliver it specifically to the tumor site. This compound has been shown to inhibit the growth of human prostate cancer cells in vitro.</p>Formula:C71H110N22O18SPurity:Min. 95%Molecular weight:1,591.84 g/mol


