CAS 668433-57-6

(~2~H_37_)Octadecane-1-thiol

Description:

Octadecane-1-thiol, with the chemical formula C18H38S and CAS number 668433-57-6, is a long-chain aliphatic thiol characterized by the presence of a thiol (-SH) functional group attached to an octadecane backbone. This compound is a colorless to pale yellow liquid at room temperature and is known for its hydrophobic properties due to the long hydrocarbon chain. It exhibits typical thiol characteristics, such as a strong, often unpleasant odor, and is soluble in organic solvents while being insoluble in water. Octadecane-1-thiol is commonly used in various applications, including as a surfactant, in the synthesis of self-assembled monolayers (SAMs) on metal surfaces, and in the development of nanomaterials. Its ability to form strong bonds with metals makes it valuable in surface modification and functionalization processes. Additionally, it can participate in various chemical reactions, including oxidation and substitution, making it a versatile compound in organic chemistry and materials science.

Formula: C₁₈HD₃₇S

InChI: InChI=1/C18H38S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19/h19H,2-18H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2,16D2,17D2,18D2

SMILES: C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(S)([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]

Synonyms:

• (2H37)Octadecane-1-thiol
• 1-Octadecane-d37-thiol
• 668433-57-6
• SH18 & & Deutero-D37

1-Octadecane-d37-thiol

CAS: 668433-57-6

Formula: CD₃(CD₂)₁₇SH

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 323.50166

Ref: 3U-D6744

1-Octadecane-d37-thiol

Controlled Product

CAS: 668433-57-6

Applications 1-Octadecane-d37-thiol (CAS# 668433-57-6) is a useful isotopically labeled research compound.

Formula: C₁₈HD₃₇S

Color and Shape: Neat

Molecular weight: 323.79

Ref: TR-O235306