CAS 66845-32-7

diiodoplatinum(2+) cyclohexane-1,2-diyldiazanide

Description:

Diiodoplatinum(2+) cyclohexane-1,2-diyldiazanide, with the CAS number 66845-32-7, is a coordination compound featuring platinum in a +2 oxidation state, coordinated with iodide ions and a bidentate ligand derived from cyclohexane-1,2-diamine. This compound typically exhibits characteristics associated with platinum complexes, such as potential cytotoxicity and unique electronic properties due to the presence of platinum. The iodide ligands contribute to the compound's stability and solubility in various solvents, while the cyclohexane-1,2-diyldiazanide ligand introduces steric and electronic effects that can influence reactivity and coordination geometry. Diiodoplatinum(2+) complexes are of interest in medicinal chemistry, particularly in the development of anticancer agents, as they may interact with biological macromolecules. The compound's properties, including its solubility, stability, and reactivity, can vary depending on the specific conditions, such as pH and temperature. Overall, this compound exemplifies the diverse chemistry of platinum coordination complexes and their potential applications in various fields.

Formula: C₆H₁₂I₂N₂Pt

InChI: InChI=1/C6H12N2.2HI.Pt/c7-5-3-1-2-4-6(5)8;;;/h5-8H,1-4H2;2*1H;/q-2;;;+4/p-2/rC6H12N2.I2Pt/c7-5-3-1-2-4-6(5)8;1-3-2/h5-8H,1-4H2;/q-2;+2

SMILES: C1CCC(C(C1)[NH-])[NH-].I.I.[Pt]

Oxaliplatin Related Compound F ([SP-4-2-(1R-trans)]-(1,2-cyclohexanediamine-N,N') diiodidoplatinum(II))

CAS: 66845-32-7

Inorganic or organic compounds of precious metals, whet

Formula: C₆H₁₄N₂I₂Pt

Color and Shape: Powder

Molecular weight: 562.88943

Ref: 45-1481260

Platinum,[(1R,2R)-1,2-cyclohexanediamine-κN1,κN2]diiodo-,(SP-4-2)-

CAS: 66845-32-7

Platinum,[(1R,2R)-1,2-cyclohexanediamine-κN1,κN2]diiodo-,(SP-4-2)-

Purity: 98%

Ref: 54-IN12479

[SP-4-2-(1R-trans)]-(1,2-Cyclohexanediamine-κN,κN') Diiodoplatinum

CAS: 66845-32-7

Applications [SP-4-2-(1R-trans)]-(1,2-Cyclohexanediamine-κN,κN')diiodoplatinum is a potential antitumor agent. Impurity of Oxiplatin (O845075), third generation platinum complex. An antitumor agent with activity against colorectal cancer. Cytotoxicity follows the formation of adducts with DNA. Antineoplastic.
References Kidani, Y. et al.: Biomed. Pharmacther., 43, 261 (1989); Noji, M. et al.: J. Med. Chem., 24, 508 (1981); Kidani, Y., et al.: J. Med. Chem., 21, 1315 (1978), Kizu, R., et al.: Cancer Chemother. Pharmacol., 31, 475 (1993), Levi, F., et al.: Eur. J. Cancer, 29A, 1280 (1993), Simpson, D., et al.: Drugs, 63, 2127 (2003),

Formula: C₆H₁₄I₂N₂Pt

Color and Shape: Neat

Molecular weight: 563.08

Ref: TR-C984525