CAS 66845-42-9
:N-Benzyloxycarbonyl-N-epsilon-tert-butoxycarbonyl-L-lysine
Description:
N-Benzyloxycarbonyl-N-epsilon-tert-butoxycarbonyl-L-lysine, commonly referred to as Z-Lys(Boc)-OH, is a protected form of the amino acid lysine, which is essential in protein synthesis. This compound features two protective groups: the benzyloxycarbonyl (Z) group and the tert-butoxycarbonyl (Boc) group, which are used to prevent unwanted reactions during peptide synthesis. The presence of these protective groups enhances the stability of the lysine side chain while allowing for selective deprotection at specific stages of synthesis. The compound is typically a white to off-white solid and is soluble in organic solvents like dichloromethane and dimethylformamide, but less soluble in water. Its molecular structure includes a primary amine group, which is characteristic of lysine, and the bulky Boc group, which imparts steric hindrance, making it useful in various synthetic applications. This compound is often utilized in the field of peptide chemistry and drug development, where precise control over amino acid functionality is crucial.
Formula:C19H28N2O6
InChI:InChI=1/C19H28N2O6/c1-19(2,3)27-17(24)20-12-8-7-11-15(16(22)23)21-18(25)26-13-14-9-5-4-6-10-14/h4-6,9-10,15H,7-8,11-13H2,1-3H3,(H,20,24)(H,21,25)(H,22,23)/t15-/m1/s1
SMILES:CC(C)(C)OC(=NCCCC[C@H](C(=O)O)N=C(O)OCc1ccccc1)O
Synonyms:- N(alpha)-Z-N(epsilon)-boc-D-lysine
- na-cbz-N-epsilon-T-boc-D-lysine
- Z-D-Lys(Boc)-OH (cryst.)
- Z-D-Lys(Boc)-OH
- Benzyloxycarbonylbutoxycarbonyllysine
- Boc-D-Phg-OH~N-(tert-Butoxycarbonyl)-D-phenylglycine
- N2-Benzyloxycarbonyl-N6-tert-butoxycarbonyl-D-lysine
- N~2~-[(benzyloxy)carbonyl]-N~6~-(tert-butoxycarbonyl)-D-lysine
- Z-Lys(Boc)-OH
- Butoxycarbonylcarbobenzoxylysine
- N-a-CBZ-(N-e-BOC)-L-Lys
- n^(epsilum)-(tert-Butoxycarbonyl)-N^(alpha)-carbobenzoxy-L-lysine
- N-benzyloxycarbonyl-n'-(tert-butoxycarbonyl)-l-lysine
- N~2~-[(benzyloxy)carbonyl]-N~6~-(tert-butoxycarbonyl)-L-lysine
- N~2~-[(benzyloxy)carbonyl]-N~6~-(tert-butoxycarbonyl)lysine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-D-lysine
CAS:Formula:C19H28N2O6Purity:97%Color and Shape:LiquidMolecular weight:380.4354Z-D-Lys(Boc)-OH
CAS:Z-D-Lys(Boc)-OH is a synthetic peptidomimetic that has been shown to selectively kill cancer cells. Z-D-Lys(Boc)-OH binds to the lysine residue on the target cell surface, which is not present in normal cells. This binding inhibits serine protease activity and disrupts the synthesis of peptides, which are essential for cellular function. The electron microscopic images show that this compound causes an enhancement of biological function in human pathogenic chlamydia.
Formula:C19H28N2O6Purity:Min. 95%Molecular weight:380.44 g/mol




