CAS 66849-29-4

(1S)-N-(2-hydroxyethyl)-1-phenylethanaminium

Description:

(1S)-N-(2-hydroxyethyl)-1-phenylethanaminium, with the CAS number 66849-29-4, is an organic compound characterized by its amine functional group and a phenyl group attached to a chiral center. This substance features a hydroxyethyl substituent, which contributes to its solubility and potential reactivity. The presence of the hydroxyl group enhances its ability to form hydrogen bonds, influencing its physical properties such as boiling point and solubility in polar solvents. As a quaternary ammonium compound, it may exhibit surfactant properties, making it useful in various applications, including pharmaceuticals and as a potential intermediate in organic synthesis. The stereochemistry indicated by the (1S) designation suggests specific spatial arrangements of its atoms, which can significantly affect its biological activity and interaction with other molecules. Overall, this compound's unique structure and functional groups make it a subject of interest in both chemical research and practical applications.

Formula: C₁₀H₁₆NO

InChI: InChI=1/C10H15NO/c1-9(11-7-8-12)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3/p+1/t9-/m0/s1

(S)-2-((1-Phenylethyl)amino)ethanol

CAS: 66849-29-4

Formula: C₁₀H₁₅NO

Color and Shape: Solid

Molecular weight: 165.2322

Ref: IN-DA00IBNA

2-[[(1S)-1-Phenylethyl]amino]ethanol

CAS: 66849-29-4

Versatile small molecule scaffold

Formula: C₁₀H₁₅NO

Purity: Min. 95%

Molecular weight: 165.23 g/mol

Ref: 3D-RCA84929