CymitQuimica logo

CAS 66851-75-0

:

L-valyl-L-glutaminyl-L-alanyl-L-alanyl-L-isoleucyl-L-alpha-aspartyl-L-tyrosyl-L-isoleucyl-L-asparaginylglycine

Description:
L-valyl-L-glutaminyl-L-alanyl-L-alanyl-L-isoleucyl-L-alpha-aspartyl-L-tyrosyl-L-isoleucyl-L-asparaginylglycine, with CAS number 66851-75-0, is a synthetic peptide composed of a sequence of amino acids. This compound is characterized by its specific arrangement of amino acids, which contributes to its unique properties and potential biological activities. Peptides like this one often exhibit various functions, including roles in signaling pathways, enzyme activity modulation, and potential therapeutic applications. The presence of multiple hydrophobic and polar amino acids in its structure suggests that it may have diverse interactions with biological membranes and proteins. Additionally, the peptide's stability, solubility, and reactivity can be influenced by factors such as pH, temperature, and the presence of other ions or molecules. While specific biological activities and applications may vary, peptides of this nature are often studied for their potential in drug development, biochemistry, and molecular biology. Further research is necessary to fully elucidate its properties and potential uses in scientific and medical fields.
Formula:C47H74N12O16
InChI:InChI=1/C47H74N12O16/c1-9-22(5)37(58-40(68)25(8)52-39(67)24(7)53-42(70)28(15-16-32(48)61)54-45(73)36(50)21(3)4)46(74)57-31(19-34(63)64)43(71)55-29(17-26-11-13-27(60)14-12-26)44(72)59-38(23(6)10-2)47(75)56-30(18-33(49)62)41(69)51-20-35(65)66/h11-14,21-25,28-31,36-38,60H,9-10,15-20,50H2,1-8H3,(H2,48,61)(H2,49,62)(H,51,69)(H,52,67)(H,53,70)(H,54,73)(H,55,71)(H,56,75)(H,57,74)(H,58,68)(H,59,72)(H,63,64)(H,65,66)/t22-,23-,24-,25-,28-,29-,30-,31-,36-,37-,38-/m0/s1
InChI key:OBUGXZVDQXDGTF-VEJNRXSDSA-N
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H](CC(=O)O)C(=N[C@@H](Cc1ccc(cc1)O)C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](CC(=N)O)C(=NCC(=O)O)O)O)O)O)O)N=C([C@H](C)N=C([C@H](C)N=C([C@H](CCC(=N)O)N=C([C@H](C(C)C)N)O)O)O)O
Found 3 products.