CAS 6686-70-0
:destruxin A from metarhizium anisopliae
Description:
Destruxin A is a cyclic peptide toxin produced by the fungus Metarhizium anisopliae, which is known for its insecticidal properties. This compound belongs to a class of molecules known as destruxins, which are characterized by their unique cyclic structure and biological activity. Destruxin A exhibits potent insecticidal effects, primarily by disrupting cellular processes in target organisms, leading to paralysis and death. Its mechanism of action involves interference with the host's immune response and apoptosis pathways. The compound has garnered interest for its potential applications in biopesticides and as a model for developing new therapeutic agents due to its specific action on insect cells. Additionally, destruxin A has been studied for its cytotoxic effects on mammalian cells, indicating a broader spectrum of biological activity. However, its use in agriculture and medicine requires careful consideration of its toxicity and environmental impact. Overall, destruxin A represents a fascinating example of natural products with significant implications in both pest management and pharmacology.
Formula:C29H47N5O7
InChI:InChI=1/C29H47N5O7/c1-9-12-21-27(38)34-16-11-13-20(34)26(37)31-23(18(5)10-2)28(39)33(8)24(17(3)4)29(40)32(7)19(6)25(36)30-15-14-22(35)41-21/h9,17-21,23-24H,1,10-16H2,2-8H3,(H,30,36)(H,31,37)
SMILES:C=CCC1C(=O)N2CCCC2C(=NC(C(C)CC)C(=O)N(C)C(C(C)C)C(=O)N(C)C(C)C(=NCCC(=O)O1)O)O
Synonyms:- Destruxin A
- Brn 0601694
- Nsc 361126
- 3-(butan-2-yl)-5,8,9-trimethyl-6-(propan-2-yl)-16-(prop-2-en-1-yl)dodecahydropyrrolo[1,2-d][1,4,7,10,13,16]oxapentaazacyclononadecine-1,4,7,10,14,17(11H,16H)-hexone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Destruxin A
CAS:Formula:C29H47N5O7Purity:≥ 97.0%Color and Shape:White, off-white or pale yellow powderMolecular weight:577.71Destruxin A from Metarhizium anisopliae
CAS:Destruxin A from Metarhizium anisopliaeColor and Shape:SolidMolecular weight:577.71g/molDestruxin A
CAS:Destruxin A is a cyclic hexadepsipeptide produced by fungus causing paralysis and death in insects.Formula:C29H47N5O7Purity:98%Color and Shape:SolidMolecular weight:577.71Destruxin A
CAS:<p>Destruxin A is a cyclodepsipeptide, which is a specialized secondary metabolite originating from the entomopathogenic fungus, Metarhizium anisopliae. This bioactive compound exerts its effects through a multifaceted mode of action, primarily disrupting ion channels and perturbing cellular homeostasis within insect hosts. The interference with calcium and potassium ion fluxes leads to paralysis and ultimately death of the targeted pests, making it an effective biocontrol agent. Destruxin A holds significant potential in integrated pest management programs, particularly in agriculture, where it offers a sustainable alternative to synthetic chemical pesticides. Its specificity to insect physiology ensures minimal impacts on non-target organisms, promoting ecological balance. Studies continue to explore its application spectrum and effectiveness, seeking to optimize its deployment in various pest-infested environments, including crops and stored products.</p>Formula:C29H47N5O7Purity:Min. 95%Color and Shape:PowderMolecular weight:577.71 g/mol



