CAS 66863-43-2
:N-Boc-L-1,2,3,4-Tetrahydro-beta-carboline-3-carboxylic acid
Description:
N-Boc-L-1,2,3,4-Tetrahydro-beta-carboline-3-carboxylic acid is a chemical compound characterized by its bicyclic structure, which includes a beta-carboline moiety. This compound features a tert-butyloxycarbonyl (Boc) protecting group on the nitrogen atom, which is commonly used in peptide synthesis to protect amines. The presence of a carboxylic acid functional group contributes to its acidic properties, making it soluble in polar solvents. The tetrahydro-beta-carboline structure is known for its potential biological activities, including neuroprotective effects and interactions with various receptors. This compound is often utilized in medicinal chemistry and research related to the synthesis of bioactive molecules. Its CAS number, 66863-43-2, uniquely identifies it in chemical databases, facilitating its study and application in various scientific fields. Overall, N-Boc-L-1,2,3,4-Tetrahydro-beta-carboline-3-carboxylic acid is a versatile compound with significant implications in organic synthesis and pharmacology.
Formula:C17H19N2O4
InChI:InChI=1/C17H20N2O4/c1-17(2,3)23-16(22)19-9-13-11(8-14(19)15(20)21)10-6-4-5-7-12(10)18-13/h4-7,14,18H,8-9H2,1-3H3,(H,20,21)/p-1/t14-/m0/s1
SMILES:CC(C)(C)OC(=O)N1Cc2c(C[C@H]1C(=O)[O-])c1ccccc1[nH]2
Synonyms:- (S)-2-(tert-Butoxycarbonyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid
- (3S)-2-(tert-butoxycarbonyl)-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid
- (3S)-2-(tert-butoxycarbonyl)-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate
- Boc-L-Tpi-OH
- Boc-L-1,2,3,4-Tetrahydronorharman-3-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Boc-L-1,2,3,4-tetrahydro-norharman-3-carboxylic acid
CAS:Formula:C17H20N2O4Purity:98%Color and Shape:SolidMolecular weight:316.3517(S)-1,2,3,4-Tetrahydronorharman-3-carboxylic acid, N2-BOC protected
CAS:(S)-1,2,3,4-Tetrahydronorharman-3-carboxylic acid, N2-BOC protectedPurity:98%Molecular weight:316.35g/molBoc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid
CAS:Formula:C17H20N2O4Purity:98%Color and Shape:SolidMolecular weight:316.357Boc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid
CAS:Boc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid is a versatile building block that can be used as a reaction component in the synthesis of complex compounds. It can also be used as a starting material in the preparation of high quality research chemicals. Boc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid has CAS number 66863-43-2 and is a speciality chemical with many uses.Formula:C17H20N2O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:316.35 g/mol




