CymitQuimica logo

CAS 66869-70-3

:

2-Propynoic acid, 3-(2-pyridinyl)-, ethyl ester

Description:
2-Propynoic acid, 3-(2-pyridinyl)-, ethyl ester, with the CAS number 66869-70-3, is an organic compound characterized by its structure, which includes a propynoic acid moiety and a pyridine ring. This compound typically exhibits properties associated with both carboxylic acids and esters, including the ability to participate in various chemical reactions such as esterification and nucleophilic substitution. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry and may influence its reactivity and solubility in different solvents. Generally, compounds of this nature can be used in organic synthesis and may exhibit biological activity, making them of interest in medicinal chemistry. The ethyl ester form suggests that it is likely to be a liquid at room temperature, with a characteristic odor. As with many organic compounds, safety precautions should be taken when handling, as they may be irritants or toxic. Overall, this compound's unique structure allows for diverse applications in chemical research and industry.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c1-2-13-10(12)7-6-9-5-3-4-8-11-9/h3-5,8H,2H2,1H3
InChI key:XOYXKNZOKZGKAB-UHFFFAOYSA-N
SMILES:CCOC(=O)C#CC1=CC=CC=N1
Found 3 products.