CAS 6688-49-9
:(3S,4R,4aR,6S,6aS,7S,8R,8aS,8bR,9S,9aS)-Hexahydro-3,6a,9-trimethyl-7-(1-methylethyl)-6,9-methanobenzo[1,2]pentaleno[1,6-bc]furan-4,6,7,8,8a,8b,9a(6aH,9H)-heptol
Description:
The chemical substance with the name "(3S,4R,4aR,6S,6aS,7S,8R,8aS,8bR,9S,9aS)-Hexahydro-3,6a,9-trimethyl-7-(1-methylethyl)-6,9-methanobenzo[1,2]pentaleno[1,6-bc]furan-4,6,7,8,8a,8b,9a(6aH,9H)-heptol" and CAS number "6688-49-9" is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple stereocenters contributing to its chiral nature. This compound features a fused ring system that incorporates both furan and benzo structures, indicating potential aromatic characteristics. The presence of multiple methyl and isopropyl groups suggests a degree of hydrophobicity, which may influence its solubility and reactivity. Additionally, the specific stereochemistry indicated by the (S) and (R) designations implies that the compound may exhibit unique biological activity or interactions, making it of interest in fields such as medicinal chemistry or natural product synthesis. Its heptol classification suggests the presence of multiple hydroxyl groups, which could enhance its reactivity and potential applications in various chemical processes. Overall, this compound exemplifies the complexity and diversity found in organic chemistry.
Formula:C20H32O8
InChI:InChI=1S/C20H32O8/c1-9(2)17(25)12(22)18(26)13(4)8-16(24)14(17,5)20(18,27)19(28-16)11(21)10(3)6-7-15(13,19)23/h9-12,21-27H,6-8H2,1-5H3/t10-,11+,12+,13-,14-,15-,16-,17+,18+,19+,20+/m0/s1
InChI key:InChIKey=POSDEVOSMOCDHR-BPHXWNOMSA-N
SMILES:O[C@@]12[C@@]34[C@@](O)([C@@]5(C)[C@]1(O)[C@H](O)[C@@](C(C)C)(O)[C@]2(C)[C@@](O)(O3)C5)CC[C@H](C)[C@H]4O
Synonyms:- 6,9-Methanobenzo[1,2]pentaleno[1,6-bc]furan-4,6α,7,8,8aα,8bα,9aα(6aH)-heptol, 1,2,3,4α,7,8α,8a,9-octahydro-7β-isopropyl-3α,6aα,9α-trimethyl-
- (+)-Ryanodol
- (3S,4R,4aR,6S,6aS,7S,8R,8aS,8bR,9S,9aS)-Hexahydro-3,6a,9-trimethyl-7-(1-methylethyl)-6,9-methanobenzo[1,2]pentaleno[1,6-bc]furan-4,6,7,8,8a,8b,9a(6aH,9H)-heptol
- 6,9-Methanobenzo[1,2]pentaleno[1,6-bc]furan-4,6,7,8,8a,8b,9a(6aH,9H)-heptol, hexahydro-3,6a,9-trimethyl-7-(1-methylethyl)-, (3S,4R,4aR,6S,6aS,7S,8R,8aS,8bR,9S,9aS)-
- Ryanodol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
