CAS 66892-01-1
:1-(2-methylprop-2-en-1-yl)thiourea
Description:
1-(2-Methylprop-2-en-1-yl)thiourea, with the CAS number 66892-01-1, is an organic compound characterized by the presence of a thiourea functional group, which consists of a carbon atom double-bonded to sulfur and bonded to an amine group. This compound features a branched alkene substituent, specifically a 2-methylprop-2-en-1-yl group, which contributes to its reactivity and potential applications in organic synthesis. Typically, thioureas exhibit properties such as moderate solubility in polar solvents and can participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The presence of the alkene moiety may also allow for additional reactivity, such as polymerization or cross-linking under certain conditions. As with many thioureas, it is essential to handle this compound with care due to potential toxicity and environmental considerations. Overall, 1-(2-methylprop-2-en-1-yl)thiourea is of interest in fields such as medicinal chemistry and materials science, where its unique structure can be leveraged for the development of new compounds or materials.
Formula:C5H10N2S
InChI:InChI=1/C5H10N2S/c1-4(2)3-7-5(6)8/h1,3H2,2H3,(H3,6,7,8)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(2-Methylprop-2-en-1-yl)thiourea
CAS:<p>(2-Methylprop-2-en-1-yl)thiourea is a lead compound that has been shown to have acetylcholinesterase and butyrylcholinesterase inhibitory activity. It has been shown to have antioxidant properties and may be used as an antiinflammatory agent. This drug has also been shown to have neuroprotective effects in animals with Alzheimer's disease by inhibiting the progression of the disease. The biological activity of (2-Methylprop-2-en-1-yl)thiourea is not limited to mammals, as it has also been shown to protect against oxidative damage in cells from pigs, horses, and chickens.</p>Formula:C5H10N2SPurity:Min. 95%Molecular weight:130.21 g/mol
