CAS 66892-25-9

1-(2-Tetrahydrofurfuryl)-2-thiourea

Description:

1-(2-Tetrahydrofurfuryl)-2-thiourea, with the CAS number 66892-25-9, is an organic compound characterized by the presence of a thiourea functional group and a tetrahydrofurfuryl moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, which is common for thiourea derivatives. The presence of the tetrahydrofurfuryl group contributes to its potential reactivity and interaction with various biological systems. Thioureas are known for their diverse applications, including use in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The compound may exhibit biological activity, including potential antimicrobial or antifungal properties, although specific biological data may vary. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many thiourea derivatives, safety precautions should be taken when handling this compound due to potential toxicity and reactivity. Overall, 1-(2-Tetrahydrofurfuryl)-2-thiourea represents a versatile structure with potential applications in various fields of chemistry and biology.

Formula: C₆H₁₂N₂OS

InChI: InChI=1/C6H12N2OS/c7-6(10)8-4-5-2-1-3-9-5/h5H,1-4H2,(H3,7,8,10)

SMILES: C1CC(CNC(=N)S)OC1

Synonyms:

• 1-(Tetrahydrofuran-2-Ylmethyl)Thiourea

[(Tetrahydrofuran-2-yl)methyl]thiourea

CAS: 66892-25-9

Formula: C₆H₁₂N₂OS

Purity: >98.0%(HPLC)(N)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 160.24

Ref: 3B-T3413

[(oxolan-2-yl)methyl]thiourea

CAS: 66892-25-9

Formula: C₆H₁₂N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.2373

Ref: IN-DA00FBBT

1-(2-Tetrahydrofurfuryl)-2-thiourea

CAS: 66892-25-9

1-(2-Tetrahydrofurfuryl)-2-thiourea

Molecular weight: 160.23728g/mol

Ref: 54-OR1020815

1-(2-TETRAHYDROFURFURYL)-2-THIOUREA

CAS: 66892-25-9

Purity: ≥98%

Molecular weight: 160.24

Ref: 10-F980545

1-(2-Tetrahydrofurfuryl)-2-thiourea

Controlled Product

CAS: 66892-25-9

Formula: C₆H₁₂N₂OS

Color and Shape: Neat

Molecular weight: 160.237

Ref: TR-T293790

[(Tetrahydrofuran-2-yl)methyl]thiourea

CAS: 66892-25-9

[(Tetrahydrofuran-2-yl)methyl]thiourea is a thiourea that functions as an antimicrobial agent. It has been shown to be effective against fungal strains, including Candida albicans, Cryptococcus neoformans, and Aspergillus fumigatus. [(Tetrahydrofuran-2-yl)methyl]thiourea has also been shown to inhibit the growth of biofilms and human cell lines. The antimicrobial activity of thiourea can be attributed to its ability to form reactive oxygen species that cause oxidative stress in microbial cells. Thiourea disrupts the cell membrane and causes leakage of cellular contents such as proteins and nucleic acids. This disruption results in cell death by apoptosis or necrosis.

Formula: C₆H₁₂N₂OS

Purity: Min. 95%

Molecular weight: 160.24 g/mol

Ref: 3D-RCA89225