CAS 66892-30-6

1-(2-methoxybenzyl)thiourea

Description:

1-(2-Methoxybenzyl)thiourea is an organic compound characterized by the presence of a thiourea functional group, which consists of a carbon atom double-bonded to sulfur and single-bonded to nitrogen atoms. This compound features a methoxy-substituted benzyl group, contributing to its aromatic properties and potentially influencing its reactivity and solubility. Typically, thioureas exhibit a range of biological activities, including antimicrobial and anticancer properties, making them of interest in medicinal chemistry. The presence of the methoxy group can enhance lipophilicity, affecting the compound's interaction with biological membranes. In terms of physical properties, thioureas generally have moderate melting points and solubility in polar solvents, although specific values for 1-(2-methoxybenzyl)thiourea would need to be referenced from experimental data. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or cyclizations, due to the reactivity of the thiourea moiety. Overall, 1-(2-methoxybenzyl)thiourea represents a versatile structure with potential applications in pharmaceuticals and organic synthesis.

Formula: C₉H₁₂N₂OS

InChI: InChI=1/C9H12N2OS/c1-12-8-5-3-2-4-7(8)6-11-9(10)13/h2-5H,6H2,1H3,(H3,10,11,13)

SMILES: COc1ccccc1CNC(=N)S

Synonyms:

• (2-Methoxy-benzyl)-thiourea

[(2-Methoxyphenyl)methyl]thiourea

CAS: 66892-30-6

Versatile small molecule scaffold

Formula: C₉H₁₂N₂OS

Purity: Min. 95%

Molecular weight: 196.27 g/mol

Ref: 3D-RCA89230