CAS 66896-64-8

2,4-dichloro-N-methylbenzamide

Description:

2,4-Dichloro-N-methylbenzamide is an organic compound characterized by its structure, which includes a benzene ring substituted with two chlorine atoms at the 2 and 4 positions, and a methylamide group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents. It is primarily used in agricultural applications, particularly as a herbicide, due to its ability to inhibit specific biochemical pathways in plants. The presence of chlorine atoms enhances its biological activity and stability. In terms of safety, it is essential to handle this compound with care, as it may pose risks to human health and the environment, necessitating appropriate safety measures during use and disposal. Additionally, its chemical properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other substances. Overall, 2,4-dichloro-N-methylbenzamide is significant in both industrial and research contexts, particularly in the study of herbicidal mechanisms.

Formula: C₈H₇Cl₂NO

InChI: InChI=1/C8H7Cl2NO/c1-11-8(12)6-3-2-5(9)4-7(6)10/h2-4H,1H3,(H,11,12)