CymitQuimica logo

CAS 668969-70-8

:

Ethyl 5-bromobenzo[d]isoxazole-3-carboxylate

Description:
Ethyl 5-bromobenzo[d]isoxazole-3-carboxylate is a chemical compound characterized by its unique structure, which includes a benzo[d]isoxazole core substituted with a bromine atom and an ethyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the isoxazole ring, which is known for its role in various pharmacological applications. The ethyl ester group contributes to its solubility in organic solvents, making it suitable for various synthetic applications. Additionally, the bromine substituent can enhance the compound's reactivity, allowing for further chemical modifications. Ethyl 5-bromobenzo[d]isoxazole-3-carboxylate may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, this compound is of interest in medicinal chemistry and materials science due to its structural features and potential utility in drug development and synthesis.
Formula:C10H8BrNO3
InChI:InChI=1/C10H8BrNO3/c1-2-14-10(13)9-7-5-6(11)3-4-8(7)15-12-9/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1c2cc(ccc2on1)Br
Synonyms:
  • 5-Bromo-1,2-benzisoxazole-3-carboxylic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.