CAS 668981-02-0

6-[4-(2,5-Difluorophenyl)-5-oxazolyl]-3-(1-methylethyl)-1,2,4-triazolo[4,3-a]pyridine

Description:

6-[4-(2,5-Difluorophenyl)-5-oxazolyl]-3-(1-methylethyl)-1,2,4-triazolo[4,3-a]pyridine is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole and pyridine ring fused together. The presence of a 2,5-difluorophenyl group and an oxazole moiety contributes to its unique chemical properties and potential biological activity. This compound is typically synthesized through multi-step organic reactions, involving the formation of various functional groups that enhance its reactivity and solubility. It may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's molecular interactions, stability, and reactivity can be influenced by the presence of fluorine atoms, which often enhance lipophilicity and bioavailability. As with many heterocyclic compounds, its applications may extend to fields such as agrochemicals or materials science, depending on its specific properties and behavior in various environments.

Formula: C₁₈H₁₄F₂N₄O

InChI: InChI=1S/C18H14F2N4O/c1-10(2)18-23-22-15-6-3-11(8-24(15)18)17-16(21-9-25-17)13-7-12(19)4-5-14(13)20/h3-10H,1-2H3

InChI key: InChIKey=UACOXBQBNWQWOK-UHFFFAOYSA-N

SMILES: FC1=C(C2=C(OC=N2)C3=CN4C(C=C3)=NN=C4C(C)C)C=C(F)C=C1

Synonyms:

• 6-[4-(2,5-Difluorophenyl)oxazol-5-yl]-3-isopropyl-[1,2,4]triazolo[4,3-a]pyridine
• 6-[4-(2,5-Difluorophenyl)-5-oxazolyl]-3-(1-methylethyl)-1,2,4-triazolo[4,3-a]pyridine
• 1,2,4-Triazolo[4,3-a]pyridine, 6-[4-(2,5-difluorophenyl)-5-oxazolyl]-3-(1-methylethyl)-

CP-863187

CAS: 668981-02-0

CP-863187 is a potent, selective, and orally bioavailable tyrosine kinase inhibitor with anti-cancer activity. CP-863187 inhibits the growth of cancer cells by blocking the activity of the epidermal growth factor receptor (EGFR) and its downstream signaling pathways that regulate cell proliferation and apoptosis. CP-863187 has been shown to inhibit mutant EGFR in non-small cell lung cancer (NSCLC) cells. CP-863187 also blocks the activities of other tyrosine kinases involved in NSCLC, including MET, AXL, RET, and KIT. CP-863187 has been shown to be safe in animal studies and is currently being evaluated for use in humans as a targeted therapy for EGFR mutant NSCLC.

Formula: C₁₈H₁₄F₂N₄O

Purity: Min. 95%

Molecular weight: 340.3 g/mol

Ref: 3D-TBB98102

CP-281384

CAS: 668981-02-0

CP-281384 is a potent, p38alpha-selective inhibitor.

Formula: C₁₈H₁₄F₂N₄O

Purity: 98%

Color and Shape: Solid

Molecular weight: 340.33

Ref: TM-T27062