CAS 669-90-9
:2-keto-D-Gluconic acid
Description:
2-Keto-D-gluconic acid, also known as 2-keto-D-gluconate, is a naturally occurring organic compound classified as a keto sugar and an aldonic acid. It is characterized by its molecular structure, which includes a ketone functional group at the second carbon position and a carboxylic acid group at the terminal carbon. This compound is typically found in various biological systems and can be involved in metabolic pathways. It is a white to off-white crystalline solid that is soluble in water, making it useful in various biochemical applications. The compound exhibits properties such as being a reducing agent and can participate in various chemical reactions, including esterification and oxidation. Its CAS number, 669-90-9, is a unique identifier used for regulatory and safety purposes. 2-Keto-D-gluconic acid is of interest in food chemistry and pharmaceuticals, where it may serve as a precursor for the synthesis of other compounds or as a potential therapeutic agent due to its biological activity.
Formula:C6H10O7
InChI:InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/t2-,3-,4+/m1/s1
InChI key:InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-N
SMILES:[C@H]([C@@H]([C@@H](CO)O)O)(C(C(O)=O)=O)O
Synonyms:- 2-Ketogluconic acid
- 2-Oxo-<span class="text-smallcaps">D</span>-gluconic acid
- 2-keto-<span class="text-smallcaps">D</span>-Gluconate
- 2-keto-<span class="text-smallcaps">D</span>-Gluconic acid
- 2-keto-Gluconic acid
- <span class="text-smallcaps">D</span>-Gluconic acid, 2-keto-
- <span class="text-smallcaps">D</span>-Glucosonic acid
- <span class="text-smallcaps">D</span>-Mannonic acid, 2-keto-
- <span class="text-smallcaps">D</span>-arabino-2-Hexulosonic acid
- <span class="text-smallcaps">D</span>-arabino-Hexonic acid, 2-keto-
- <span class="text-smallcaps">D</span>-arabino-Hexulosonic acid
- D-arabino-2-Hexulosonic acid
- D-arabino-Hexulosonic acid
- D-lyxo-hex-5-ulofuranosonic acid
- Hex-2-Ulosonic Acid
- α-Ketogluconic acid
- D-arabino-Hexonic acid, 2-keto-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Keto-D-gluconic acid
CAS:2-Keto-D-gluconic acid is a naturally occurring compound that can be synthesized from sodium carbonate and 2-keto-d-gluconic acid. 2-Keto-D-gluconic acid has been shown to have antimicrobial properties against many bacterial strains, including its ability to inhibit the growth of wild type strains of Staphylococcus aureus, Streptococcus pneumoniae, Escherichia coli, and Pseudomonas aeruginosa. It has also been shown to have antiinflammatory properties. The synthesis of 2-keto-D-gluconic acid requires optimization of the process with respect to the monoclonal antibody surface methodology used.Formula:C6H10O7Purity:Min. 95%Color and Shape:PowderMolecular weight:194.14 g/mol


