CAS 66900-68-3
:platinum(2+) cyclohexane-1,2-diyldiazanide - nitric acid (1:1:2)
Description:
Platinum(2+) cyclohexane-1,2-diyldiazanide - nitric acid (1:1:2), identified by its CAS number 66900-68-3, is a coordination compound featuring platinum in a +2 oxidation state. This compound is characterized by the presence of cyclohexane-1,2-diyldiazanide ligands, which are bidentate, coordinating through nitrogen atoms to the platinum center. The nitric acid component indicates that the compound may exhibit acidic properties and could influence the solubility and stability of the complex in solution. The structure likely involves a square planar geometry typical of platinum(II) complexes, which is stabilized by the chelation of the ligands. This compound may have applications in catalysis or materials science, given the unique properties of platinum and the potential reactivity of the nitrogen-containing ligands. However, specific details regarding its reactivity, stability, and potential applications would require further investigation and characterization through experimental methods.
Formula:C6H14N4O6Pt
InChI:InChI=1/C6H12N2.2HNO3.Pt/c7-5-3-1-2-4-6(5)8;2*2-1(3)4;/h5-8H,1-4H2;2*(H,2,3,4);/q-2;;;+2
SMILES:C1CCC(C(C1)[NH-])[NH-].N(=O)(=O)O.N(=O)(=O)O.[Pt]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
OxaliplatinRelatedSubstanceB DinitrateforPurityRS
CAS:Color and Shape:White To Light Yellow Solid Crystalline Powder(1R,2R)-1,2-Cyclohexanediaminedinitrate Platinum
CAS:Controlled ProductApplications (1R,2R)-1,2-Cyclohexanediaminedinitrate Platinum is an intermediate in the synthesis of Oxaliplatin (O845075) related compounds.
Formula:C6H14N4O6PtColor and Shape:NeatMolecular weight:433.277Oxaliplatin related compound B
CAS:Oxaliplatin related compound B is a fine chemical. It is an intermediate in the preparation of oxaliplatin related compounds, which are useful as research chemicals, reagents and speciality chemicals. Oxaliplatin related compound B has been used in the synthesis of other compounds with different functional groups. It has also been shown to be a versatile building block for the synthesis of complex compounds. Oxaliplatin related compound B can be used as a reaction component for the synthesis of other compounds. Oxaliplatin related compound B is a high quality, complex compound that can be used as a scaffold for the synthesis of other compounds.Formula:C6H14N4O6PtPurity:Min. 97 Area-%Color and Shape:Slightly Yellow PowderMolecular weight:433.28 g/mol





