CAS 669002-89-5

4-Cyano-2-fluorobenzenepropanoic acid

Description:

4-Cyano-2-fluorobenzenepropanoic acid, with the CAS number 669002-89-5, is an organic compound characterized by its unique functional groups and structural features. It contains a cyano group (-CN) and a fluorine atom attached to a benzene ring, which contributes to its reactivity and potential applications in various chemical processes. The presence of the propanoic acid moiety indicates that it has acidic properties, allowing it to participate in acid-base reactions. This compound is likely to exhibit polar characteristics due to the electronegative fluorine and cyano groups, influencing its solubility in polar solvents. Additionally, the molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific reactivity and stability would depend on the surrounding conditions, such as temperature and pH. Overall, 4-Cyano-2-fluorobenzenepropanoic acid is a versatile compound with significant implications in chemical research and industry.

Formula: C₁₀H₈FNO₂

InChI: InChI=1S/C10H8FNO2/c11-9-5-7(6-12)1-2-8(9)3-4-10(13)14/h1-2,5H,3-4H2,(H,13,14)

InChI key: InChIKey=UYFHEDUDZUHCBI-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=C(F)C=C(C#N)C=C1

Synonyms:

• Benzenepropanoic acid, 4-cyano-2-fluoro-
• 4-Cyano-2-fluorobenzenepropanoic acid

3-(4-Cyano-2-fluorophenyl)propanoic acid

CAS: 669002-89-5

Versatile small molecule scaffold

Formula: C₁₀H₈FNO₂

Purity: Min. 95%

Molecular weight: 193.17 g/mol

Ref: 3D-UBB00289