CAS 669008-26-8
:1-Methylcyclopropanesulfonamide
Description:
1-Methylcyclopropanesulfonamide is a chemical compound characterized by its unique structure, which includes a cyclopropane ring substituted with a methyl group and a sulfonamide functional group. This compound typically exhibits properties associated with both cyclic and sulfonamide compounds, such as potential solubility in polar solvents due to the presence of the sulfonamide group. The sulfonamide moiety can impart biological activity, making such compounds of interest in medicinal chemistry and drug development. Additionally, the presence of the methyl group can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with biological targets. The compound's molecular structure may also lead to interesting conformational dynamics, which can be relevant in understanding its behavior in various chemical environments. Overall, 1-Methylcyclopropanesulfonamide represents a class of compounds that can be explored for various applications, particularly in pharmaceuticals, due to their unique structural features and potential biological activities.
Formula:C4H9NO2S
InChI:InChI=1S/C4H9NO2S/c1-4(2-3-4)8(5,6)7/h2-3H2,1H3,(H2,5,6,7)
InChI key:InChIKey=ATJVVVCODTXRAE-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1(C)CC1
Synonyms:- 1-Methyl-Cyclopropanesulfonic Acid Amide
- 1-Methyl-cyclopropylsulfonamide
- 1-Methylcyclopropanesulfonamide
- Cyclopropanesulfonamide, 1-Methyl-
- 1-Methylcyclopropane-1-sulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Methylcyclopropanesulfonamide
CAS:Formula:C4H9NO2SPurity:97%Color and Shape:SolidMolecular weight:135.18481-Methylcyclopropane-1-sulfonamide
CAS:1-Methylcyclopropane-1-sulfonamidePurity:97%Molecular weight:135.19g/mol1-Methylcyclopropanesulfonamide
CAS:Formula:C4H9NO2SPurity:97%Color and Shape:SolidMolecular weight:135.181-Methylcyclopropanesulphonamide
CAS:<p>1-Methylcyclopropanesulphonamide is a drug that inhibits the activity of serine protease. It has been shown to inhibit the replication of hepatitis C virus and HIV, while also inhibiting the enzymatic activity of human leukocyte elastase. This drug has a molecular weight of 226.3 g/mol and is soluble in water. 1-Methylcyclopropanesulphonamide is used for treatment of viral hepatitis, such as chronic active hepatitis, acute hepatitis, and fulminant hepatic failure. It is also used to treat inflammatory bowel disease and rheumatoid arthritis.<br>1-Methylcyclopropanesulphonamide binds reversibly to the enzyme's active site with an affinity constant (K) of 7 x 10 M at 37°C and pH 7.5 under conditions where the compound exists in its free form or as a protonated molecule. The binding mode appears to be hydrophobic in nature,</p>Formula:C4H9NO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:135.19 g/mol



