CAS 669066-89-1

3-amino-5-bromopyridine-2-carboxamide

Description:

3-Amino-5-bromopyridine-2-carboxamide is a heterocyclic organic compound characterized by its pyridine ring, which contains both amino and carboxamide functional groups. The presence of a bromine atom at the 5-position of the pyridine ring contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino and carboxamide groups, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The compound's properties, such as melting point, boiling point, and spectral characteristics (like NMR and IR), can vary based on its purity and the conditions under which it is synthesized. Additionally, safety data should be consulted, as halogenated compounds can pose specific health risks. Overall, 3-amino-5-bromopyridine-2-carboxamide is a valuable compound in the field of organic synthesis and drug discovery.

Formula: C₆H₆BrN₃O

InChI: InChI=1/C6H6BrN3O/c7-3-1-4(8)5(6(9)11)10-2-3/h1-2H,8H2,(H2,9,11)

SMILES: c1c(cnc(c1N)C(=N)O)Br

Synonyms:

• 2-Pyridinecarboxamide, 3-amino-5-bromo-
• 3-Amino-5-bromopyridine-2-carboxamide

3-Amino-5-bromopyridine-2-carboxamide

CAS: 669066-89-1

Formula: C₆H₆BrN₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 216.0353

Ref: IN-DA0033L6

3-Amino-5-bromopicolinamide

CAS: 669066-89-1

3-Amino-5-bromopicolinamide

Purity: 98%

Molecular weight: 216.04g/mol

Ref: 54-OR89990

3-Amino-5-bromopicolinamide

CAS: 669066-89-1

Formula: C₆H₆BrN₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 216.038

Ref: 10-F092492