CAS 6691-83-4

16-(acetyloxy)-3,19-dihydroxy-14,15-epoxybufa-20,22-dienolide

Description:

16-(Acetyloxy)-3,19-dihydroxy-14,15-epoxybufa-20,22-dienolide, with the CAS number 6691-83-4, is a naturally occurring compound belonging to the class of bufadienolides, which are steroidal compounds derived from toads and certain plants. This substance is characterized by its complex molecular structure, featuring multiple hydroxyl groups, an acetyloxy group, and an epoxy group, which contribute to its biological activity. It exhibits a range of pharmacological properties, including potential anti-inflammatory and anticancer effects, making it of interest in medicinal chemistry. The presence of the epoxy group suggests reactivity that may influence its interaction with biological targets. Additionally, bufadienolides are known for their cardiotonic effects, which can impact heart function. The compound's solubility, stability, and reactivity are influenced by its functional groups, making it a subject of study for its therapeutic potential and mechanisms of action in various biological systems.

Formula: C₂₆H₃₄O₇

InChI: InChI=1/C26H34O7/c1-14(28)32-22-21(15-3-6-20(30)31-12-15)24(2)9-8-18-19(26(24)23(22)33-26)5-4-16-11-17(29)7-10-25(16,18)13-27/h3,6,12,16-19,21-23,27,29H,4-5,7-11,13H2,1-2H3

SMILES: CC(=O)OC1C(c2ccc(=O)oc2)C2(C)CCC3C(CCC4CC(CCC34CO)O)C32C1O3

Cinobufaginol

CAS: 6691-83-4

Cinobufaginol is a natural product

Formula: C₂₆H₃₄O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 458.551

Ref: TM-TN1501

Cinobufaginol

CAS: 6691-83-4

Formula: C₂₆H₃₄O₇

Molecular weight: 458.55

Ref: 7W-GY3713

Cinobufaginol

CAS: 6691-83-4

Formula: C₂₆H₃₄O₇

Purity: 95%~99%

Molecular weight: 458.551

Ref: BP-BP4198

Cinobufaginol

CAS: 6691-83-4

Cinobufaginol is a bioactive compound, which is derived from the skin secretions of toads, particularly those belonging to the genus Bufo. As a member of the bufadienolide family, Cinobufaginol exerts its effects primarily through the inhibition of Na+/K+-ATPase, an enzyme critical for maintaining the ionic gradient across cell membranes. This inhibition disrupts ionic balance, leading to altered cellular signaling and potential induction of apoptosis, particularly in malignant cells.

Formula: C₂₆H₃₄O₇

Purity: Min. 95%

Molecular weight: 458.5 g/mol

Ref: 3D-GAA69183