CAS 66913-97-1
:2-(Methylsulfonyl)acetamide
Description:
2-(Methylsulfonyl)acetamide, with the CAS number 66913-97-1, is an organic compound characterized by the presence of a methylsulfonyl group attached to an acetamide structure. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to its polar functional groups. It features a sulfonyl group (-SO2-) linked to a methyl group, which contributes to its unique chemical properties, including potential reactivity in nucleophilic substitution reactions. The acetamide moiety provides hydrogen bonding capabilities, enhancing its solubility and interaction with biological systems. 2-(Methylsulfonyl)acetamide may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs or agrochemicals. Its stability under various conditions and its ability to participate in chemical reactions make it a valuable compound in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C3H7NO3S
InChI:InChI=1/C3H7NO3S/c1-8(6,7)2-3(4)5/h2H2,1H3,(H2,4,5)
InChI key:InChIKey=ZBLUAVADFAWYLL-UHFFFAOYSA-N
SMILES:C(S(C)(=O)=O)C(N)=O
Synonyms:- 2-(Methanesulfonyl)acetamide
- 2-(Methylsulfonyl)Acetamide
- 2-Methanesulfonylacetamide
- Acetamide, 2-(methylsulfonyl)-
- 2-(Methylsulphonyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

