CAS 66916-99-2
:2-Bromo-4-methoxybenzeneacetic acid
Description:
2-Bromo-4-methoxybenzeneacetic acid, with the CAS number 66916-99-2, is an organic compound characterized by the presence of a bromine atom, a methoxy group, and a carboxylic acid functional group attached to a benzene ring. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in organic solvents such as ethanol and acetone, but its solubility in water is limited due to the hydrophobic nature of the aromatic ring. The presence of the bromine atom can impart unique reactivity, making it useful in various chemical synthesis applications, including medicinal chemistry and the development of pharmaceuticals. The methoxy group can influence the compound's electronic properties and reactivity, potentially affecting its biological activity. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, 2-Bromo-4-methoxybenzeneacetic acid is a versatile compound with applications in research and industry.
Formula:C9H9BrO3
InChI:InChI=1S/C9H9BrO3/c1-13-7-3-2-6(4-9(11)12)8(10)5-7/h2-3,5H,4H2,1H3,(H,11,12)
InChI key:InChIKey=XQELSBAAFMYSMG-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(Br)C=C(OC)C=C1
Synonyms:- 2-(2-Bromo-4-methoxyphenyl)acetic acid
- 2-Bromo-4-methoxybenzeneacetic acid
- Benzeneacetic Acid, 2-Bromo-4-Methoxy-
- 2-Bromo-4-methoxyphenylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-4-methoxyphenylacetic Acid
CAS:Formula:C9H9BrO3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalineMolecular weight:245.072-Bromo-4-methoxyphenylacetic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H9BrO3Purity:97%Color and Shape:White, PowderMolecular weight:245.072-(2-Bromo-4-methoxyphenyl)acetic acid
CAS:Formula:C9H9BrO3Purity:97%Color and Shape:SolidMolecular weight:245.07002-(2-Bromo-4-methoxyphenyl)acetic acid
CAS:2-(2-Bromo-4-methoxyphenyl)acetic acidPurity:98%Molecular weight:245.07g/mol2-(2-Bromo-4-methoxyphenyl)acetic acid
CAS:2-(2-Bromo-4-methoxyphenyl)acetic acid is a versatile building block that is used as a research chemical, reaction component, and reagent. It is also used as a speciality chemical and complex compound. This compound has the CAS number 66916-99-2.Formula:C9H9BrO3Color and Shape:SolidMolecular weight:245.07 g/mol2-Bromo-4-methoxyphenylacetic acid
CAS:Formula:C9H9BrO3Purity:97%Color and Shape:SolidMolecular weight:245.072





