CAS 66918-21-6

1,6-diamino-2,5-anhydro-1,3,4,6-tetradeoxyhexitol

Description:

1,6-Diamino-2,5-anhydro-1,3,4,6-tetradeoxyhexitol, with the CAS number 66918-21-6, is a chemical compound characterized by its unique structural features, including multiple amino groups and a sugar-like backbone. This compound is a derivative of hexitol, which is a sugar alcohol, and it possesses both hydroxyl and amino functional groups that contribute to its reactivity and potential biological activity. The presence of the anhydro structure indicates that it has undergone dehydration, which can influence its solubility and stability. Typically, compounds like this may exhibit properties such as being hygroscopic and having the ability to form hydrogen bonds, which can affect their interactions in biological systems. Additionally, due to the amino groups, it may participate in various biochemical processes, potentially serving as a precursor for the synthesis of more complex molecules or as a building block in medicinal chemistry. Its specific applications and behavior would depend on further studies and context within chemical and biological systems.

Formula: C₆H₁₄N₂O

InChI: InChI=1/C6H14N2O/c7-3-5-1-2-6(4-8)9-5/h5-6H,1-4,7-8H2

SMILES: C1CC(CN)OC1CN

Tetrahydro-2,5-furandimethanamine

CAS: 66918-21-6

Tetrahydro-2,5-furandimethanamine

Purity: 98%

Molecular weight: 130.19g/mol

Ref: 54-OR1007649

Tetrahydro-2,5-furandimethanamine

CAS: 66918-21-6

Purity: 98%

Molecular weight: 130.191

Ref: 10-F987267

2,5-Bis(aminomethyl)tetrahydrofuran

CAS: 66918-21-6

2,5-Bis(aminomethyl)tetrahydrofuran is a polymerization catalyst for polyethylene terephthalate that has been shown to be effective at low temperatures. It is not active at high temperatures and is stable in acidic and neutral media. 2,5-Bis(aminomethyl)tetrahydrofuran can be used as an electrochemical catalyst for the conversion of 5-hydroxymethylfurfural (HMF) to formic acid. This reaction has been shown to have a high turnover frequency and to be sustainable because it does not require fossil fuels or heavy metals as reactants. The parameters of this reaction are still being investigated, including the effect of oxidant on the rate of catalysis.

Formula: C₆H₁₄N₂O

Purity: Min. 95%

Color and Shape: Colorless Powder

Molecular weight: 130.19 g/mol

Ref: 3D-FB18704

2,5-Bis(aminomethyl)tetrahydrofuran

Controlled Product

CAS: 66918-21-6

Applications 2,5-Bis(aminomethyl)tetrahydrofuran

Formula: C₆H₁₄N₂O

Color and Shape: Neat

Molecular weight: 130.19

Ref: TR-B404300