CAS 66927-03-5
:6-azido-6-deoxy-D-galactose
Description:
6-Azido-6-deoxy-D-galactose is a monosaccharide derivative characterized by the presence of an azido group (-N3) at the 6-position of the galactose molecule, which is a hexose sugar. This compound is notable for its potential applications in biochemistry and medicinal chemistry, particularly in the development of glycosylation reactions and as a building block for glycoprotein synthesis. The azido group can participate in click chemistry, allowing for selective reactions that facilitate the attachment of various biomolecules. In terms of physical properties, 6-azido-6-deoxy-D-galactose is typically a white to off-white solid, soluble in polar solvents such as water and methanol. Its reactivity is influenced by the azido group, which can undergo reduction to amines or participate in cycloaddition reactions. The compound's structure and functional groups make it a valuable tool in chemical biology for studying carbohydrate interactions and modifications. Safety data should be consulted, as azides can be sensitive and potentially hazardous under certain conditions.
Formula:C6H11N3O5
InChI:InChI=1/C6H11N3O5/c7-9-8-1-3(11)5(13)6(14)4(12)2-10/h2-6,11-14H,1H2/t3-,4+,5+,6-/m1/s1
Synonyms:- D-galactose, 6-azido-6-deoxy-
- 6-Azido-6-deoxy-D-galactose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Azido-6-deoxy-D-galactopyranose
CAS:Formula:C6H11N3O5Purity:min. 95.0 area%(HPLC)Color and Shape:SolidMolecular weight:205.176-Azido-6-deoxy-D-galactose
CAS:Formula:C6H11N3O5Purity:95%Color and Shape:SolidMolecular weight:205.16866-Azido-6-deoxy-D-galactose
CAS:6-Azido-6-deoxy-D-galactosePurity:>98%Color and Shape:Off-White SolidMolecular weight:205.17g/mol6-Azido-6-deoxy-D-galactose
CAS:Formula:C6H11N3O5Purity:≥ 98.0%Color and Shape:White, off-white or pale yellow-tan powderMolecular weight:205.176-Azido-6-deoxy-D-galactose
CAS:6-Azido-6-deoxy-D-galactose is a mutagenic compound that is used as a carbon source in the synthesis of other compounds. It has been shown to have mutagenicity in TA100 cells and to be active against Staudinger's naphthol. The compound is synthesised by chemoenzymatic methods, which involve the use of alcohols and an acetyl group. 6-Azido-6-deoxy-D-galactose can be used as a mutagenic agent for the production of mutants with desired properties.Formula:C6H11N3O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:205.17 g/mol6-Azido-6-deoxy-D-galactose
CAS:Controlled ProductFormula:C6H11N3O5Color and Shape:NeatMolecular weight:205.169






