CAS 66931-56-4

Oxirane, 2-[[(2-chlorophenyl)methoxy]methyl]-

Description:

Oxirane, 2-[[(2-chlorophenyl)methoxy]methyl]- is a chemical compound characterized by its epoxide structure, which features a three-membered cyclic ether known as an oxirane. This compound contains a chlorophenyl group, indicating the presence of a chlorine atom attached to a phenyl ring, which can influence its reactivity and physical properties. The methoxy group contributes to its overall polarity and can affect solubility in various solvents. Typically, compounds like this may exhibit moderate to high reactivity due to the strained oxirane ring, making them useful in various chemical reactions, including ring-opening reactions. The presence of the chlorophenyl moiety may also impart specific biological activities or interactions, making it of interest in pharmaceutical or agrochemical applications. Safety data should be consulted, as halogenated compounds can exhibit toxicity or environmental persistence. Overall, this compound's unique structure suggests potential utility in synthetic organic chemistry and materials science.

Formula: C₁₀H₁₁ClO₂

InChI: InChI=1S/C10H11ClO2/c11-10-4-2-1-3-8(10)5-12-6-9-7-13-9/h1-4,9H,5-7H2

InChI key: InChIKey=QIGRNFRVHVCFEF-UHFFFAOYSA-N

SMILES: C(OCC1CO1)C2=C(Cl)C=CC=C2

Synonyms:

• 1-(2-Chlorobenzyloxy)-2,3-epoxypropane
• Oxirane, 2-[[(2-chlorophenyl)methoxy]methyl]-
• 2-[[(2-Chlorophenyl)methoxy]methyl]oxirane
• Oxirane, [[(2-chlorophenyl)methoxy]methyl]-

2-{[(2-Chlorophenyl)methoxy]methyl}oxirane

CAS: 66931-56-4

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClO₂

Purity: Min. 95%

Molecular weight: 198.64 g/mol

Ref: 3D-RCA93156