CAS 66938-02-1
:2,3-dihydro-1H-isoindole-1-carboxylic acid
Description:
2,3-Dihydro-1H-isoindole-1-carboxylic acid is a bicyclic organic compound characterized by its isoindole structure, which consists of a fused benzene and pyrrole ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. Typically, it appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group allows for potential reactivity in various chemical reactions, including esterification and amidation. Its unique structure makes it of interest in medicinal chemistry, particularly for the development of pharmaceuticals, as it may exhibit biological activity. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature. Overall, 2,3-dihydro-1H-isoindole-1-carboxylic acid is a versatile compound with potential applications in organic synthesis and drug development.
Formula:C9H9NO2
InChI:InChI=1/C9H9NO2/c11-9(12)8-7-4-2-1-3-6(7)5-10-8/h1-4,8,10H,5H2,(H,11,12)
SMILES:c1ccc2c(c1)CNC2C(=O)O
Synonyms:- 1H-isoindole-1-carboxylic acid, 2,3-dihydro-
- Isoindoline-1-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Dihydro-1h-isoindole-1-carboxylic acid
CAS:Formula:C9H9NO2Purity:97%Color and Shape:SolidMolecular weight:163.17332,3-Dihydro-1H-isoindole-1-carboxylic acid
CAS:2,3-Dihydro-1H-isoindole-1-carboxylic acidPurity:≥95%Molecular weight:163.17g/mol2,3-Dihydro-1H-isoindole-1-carboxylic acid
CAS:2,3-Dihydro-1H-isoindole-1-carboxylic acid is an acidic molecule that can be found in high concentrations in the blood. It is also a metabolite of isoindolines, which are an important class of drugs used to treat chronic hypertension. 2,3-Dihydro-1H-isoindole-1-carboxylic acid belongs to the group of structural formula categorized as an enolate; this group is a type of enzyme inhibitor that blocks enzymes involved in the production of cholesterol. 2,3-Dihydro-1H-isoindole-1-carboxylic acid has been shown to inhibit the activity of two enzymes: cytochrome P450 and sterol C5 reductase. The mechanism behind this inhibition is homologous with other known inhibitors such as 3-(2′,4′dichlorophenyl)acrylic acid (methazFormula:C9H9NO2Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:163.17 g/mol2,3-Dihydro-1H-isoindole-1-carboxylic acid
CAS:Formula:C9H9NO2Purity:95%Color and Shape:Liquid, No data available.Molecular weight:163.176



