CAS 66938-39-4

(2-fluorophenyl)(4-methoxy-3-nitrophenyl)methanone

Description:

(2-Fluorophenyl)(4-methoxy-3-nitrophenyl)methanone, with the CAS number 66938-39-4, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of a fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity or altering its interaction with biological targets. The methoxy and nitro substituents on the other phenyl ring contribute to the compound's polarity and can affect its solubility in various solvents. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, its unique combination of functional groups suggests potential applications in materials science or as an intermediate in the synthesis of more complex molecules. Overall, the characteristics of this compound make it a subject of interest in both academic and industrial chemistry contexts.

Formula: C₁₄H₁₀FNO₄

InChI: InChI=1/C14H10FNO4/c1-20-13-7-6-9(8-12(13)16(18)19)14(17)10-4-2-3-5-11(10)15/h2-8H,1H3

SMILES: COc1ccc(cc1N(=O)=O)C(=O)c1ccccc1F

2-Fluoro-4'-methoxy-3'-nitrobenzophenone

CAS: 66938-39-4

2-Fluoro-4'-methoxy-3'-nitrobenzophenone

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 275.23g/mol

Ref: 54-PC3702