
CAS 669556-53-0
:Tetrahydro-2-[(28-phenyl-3,6,9,12,15,18,21,24,27-nonaoxaoctacos-1-yl)oxy]-2H-pyran
Description:
Tetrahydro-2-[(28-phenyl-3,6,9,12,15,18,21,24,27-nonaoxaoctacos-1-yl)oxy]-2H-pyran, identified by its CAS number 669556-53-0, is a complex organic compound characterized by its unique structural features. It contains a tetrahydropyran ring, which contributes to its cyclic ether properties, and a long alkyl chain with multiple ether linkages, indicated by the presence of nine oxygen atoms in the chain. The phenyl group attached to the alkyl chain enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The compound's structure suggests it may exhibit interesting chemical reactivity and potential applications in fields such as materials science or pharmaceuticals. Its molecular architecture may also impart specific physical properties, such as melting point, boiling point, and stability under various conditions. However, detailed studies would be necessary to fully understand its behavior, reactivity, and potential applications in various chemical contexts.
Formula:C30H52O11
InChI:InChI=1S/C30H52O11/c1-2-6-29(7-3-1)28-39-25-24-37-21-20-35-17-16-33-13-12-31-10-11-32-14-15-34-18-19-36-22-23-38-26-27-41-30-8-4-5-9-40-30/h1-3,6-7,30H,4-5,8-28H2
InChI key:InChIKey=UPOGSHHHOLZUFV-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOCCOCCOCCOCCOC1CCCCO1)C2=CC=CC=C2
Synonyms:- Tetrahydro-2-[(28-phenyl-3,6,9,12,15,18,21,24,27-nonaoxaoctacos-1-yl)oxy]-2H-pyran
- 2H-Pyran, tetrahydro-2-[(28-phenyl-3,6,9,12,15,18,21,24,27-nonaoxaoctacos-1-yl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Tetrahydro-2-[(28-phenyl-3,6,9,12,15,18,21,24,27-nonaoxaoctacos-1-yl)oxy]-2H-pyran
CAS:Formula:C30H52O11Molecular weight:588.7273Benzyl-PEG9-THP
CAS:Benzyl-PEG9-THP is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C30H52O11Color and Shape:SolidMolecular weight:588.735

