CAS 66961-19-1

2-(2-nitrophenoxy)benzaldehyde

Description:

2-(2-Nitrophenoxy)benzaldehyde, with the CAS number 66961-19-1, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde group and a nitrophenoxy substituent. This compound typically appears as a yellow to orange solid and is known for its potential applications in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. It features a nitro group (-NO2) that is electron-withdrawing, influencing its reactivity and properties. The presence of the aldehyde functional group (-CHO) allows for further chemical transformations, such as condensation reactions. Additionally, the compound may exhibit moderate solubility in organic solvents, while its stability can be affected by light and moisture. Safety precautions should be taken when handling this substance, as nitro compounds can be hazardous. Overall, 2-(2-nitrophenoxy)benzaldehyde is a valuable compound in synthetic organic chemistry, with unique characteristics stemming from its functional groups and molecular structure.

Formula: C₁₃H₉NO₄

InChI: InChI=1/C13H9NO4/c15-9-10-5-1-3-7-12(10)18-13-8-4-2-6-11(13)14(16)17/h1-9H

SMILES: c1ccc(c(c1)C=O)Oc1ccccc1N(=O)=O

2-(2-Nitrophenoxy)benzaldehyde

CAS: 66961-19-1

Versatile small molecule scaffold

Formula: C₁₃H₉NO₄

Purity: Min. 95%

Molecular weight: 243.21 g/mol

Ref: 3D-RCA96119