CAS 66962-52-5

5-(butylamino)-1,3,4-thiadiazole-2(3H)-thione

Description:

5-(Butylamino)-1,3,4-thiadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features a butylamino group, contributing to its solubility and potential biological activity. The thiadiazole moiety is known for its diverse applications in pharmaceuticals and agrochemicals due to its ability to interact with various biological targets. The thione functional group indicates the presence of a sulfur atom double-bonded to a carbon atom, which can influence the compound's reactivity and stability. Typically, compounds of this nature exhibit moderate to high polarity, affecting their solubility in organic solvents and water. Additionally, they may possess antimicrobial or antifungal properties, making them of interest in medicinal chemistry. The compound's molecular structure and functional groups suggest potential applications in drug development and agricultural chemistry, although specific biological activities would require further investigation through experimental studies.

Formula: C₆H₁₁N₃S₂

InChI: InChI=1/C6H11N3S2/c1-2-3-4-7-5-8-9-6(10)11-5/h2-4H2,1H3,(H,7,8)(H,9,10)

SMILES: CCCCN=c1[nH]nc(S)s1

Synonyms:

• 5-Butylamino-[1,3,4]thiadiazole-2-thiol

5-(Butylamino)-1,3,4-thiadiazole-2-thiol

CAS: 66962-52-5

Versatile small molecule scaffold

Formula: C₆H₁₁N₃S₂

Purity: Min. 95%

Molecular weight: 189.3 g/mol

Ref: 3D-RCA96252