CAS 669708-93-4

5-[1-(4-ethylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(4-Ethylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocycle containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of the ethylphenoxy group suggests that it may exhibit hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The methyl group on the triazole ring can affect the compound's steric properties and overall stability. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities, such as antifungal or herbicidal properties. Its specific applications and efficacy would depend on further studies and evaluations in relevant biological systems. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₃H₁₇N₃OS

InChI: InChI=1/C13H17N3OS/c1-4-10-5-7-11(8-6-10)17-9(2)12-14-15-13(18)16(12)3/h5-9H,4H2,1-3H3,(H,15,18)

SMILES: CCc1ccc(cc1)OC(C)c1nnc(n1C)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[1-(4-ethylphenoxy)ethyl]-4-methyl-
• 5-[1-(4-Ethyl-phenoxy)-ethyl]-4-methyl-4H-[1,2,4]triazole-3-thiol

5-[1-(4-ethylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 669708-93-4

Formula: C₁₃H₁₇N₃OS

Purity: 95.0%

Molecular weight: 263.36

Ref: 10-F307810