CAS 669713-68-2

3′-Ethoxy[1,1′-biphenyl]-2-acetic acid

Description:

3′-Ethoxy[1,1′-biphenyl]-2-acetic acid, identified by its CAS number 669713-68-2, is an organic compound characterized by its biphenyl structure substituted with an ethoxy group and an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential solubility in organic solvents while maintaining some degree of polarity due to the carboxylic acid group. The presence of the ethoxy group enhances its lipophilicity, which may influence its biological activity and interaction with various biological systems. As a biphenyl derivative, it may also exhibit interesting electronic properties, making it a candidate for applications in pharmaceuticals or materials science. The compound's structural features suggest potential for hydrogen bonding due to the carboxylic acid, which could affect its reactivity and interactions in chemical processes. Overall, 3′-Ethoxy[1,1′-biphenyl]-2-acetic acid represents a unique chemical entity with diverse potential applications in various fields of chemistry and biochemistry.

Formula: C₁₆H₁₆O₃

InChI: InChI=1S/C16H16O3/c1-2-19-14-8-5-7-12(10-14)15-9-4-3-6-13(15)11-16(17)18/h3-10H,2,11H2,1H3,(H,17,18)

InChI key: InChIKey=HBOWLVHGSTUVTC-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(C2=CC(OCC)=CC=C2)C=CC=C1

Synonyms:

• (3′-Ethoxy-biphenyl-2-yl)acetic acid
• 3′-Ethoxy[1,1′-biphenyl]-2-acetic acid
• [1,1'-Biphenyl]-2-acetic acid, 3'-ethoxy-

(3′-Ethoxy-biphenyl-2-yl)-acetic acid

CAS: 669713-68-2

Formula: C₁₆H₁₆O₃

Purity: 97.0%

Molecular weight: 256.301

Ref: 10-F011454