CAS 669713-78-4

2′-Chloro[1,1′-biphenyl]-3-acetic acid

Description:

2′-Chloro[1,1′-biphenyl]-3-acetic acid, with the CAS number 669713-78-4, is an organic compound characterized by its biphenyl structure substituted with a chlorine atom and an acetic acid functional group. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the biphenyl moiety. The presence of the chlorine atom introduces unique reactivity and potential for further chemical modifications, while the acetic acid group contributes to its acidic properties. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility as a synthetic intermediate. Its molecular structure allows for interactions with biological systems, which could lead to applications in drug development or as a biochemical probe. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₄H₁₁ClO₂

InChI: InChI=1S/C14H11ClO2/c15-13-7-2-1-6-12(13)11-5-3-4-10(8-11)9-14(16)17/h1-8H,9H2,(H,16,17)

InChI key: InChIKey=REUGYQBMHOOQKM-UHFFFAOYSA-N

SMILES: ClC1=C(C2=CC(CC(O)=O)=CC=C2)C=CC=C1

Synonyms:

• 2-[3-(2-Chlorophenyl)phenyl]acetic acid
• 2′-Chloro-biphenyl-3-acetic acid
• 2′-Chloro[1,1′-biphenyl]-3-acetic acid
• [1,1'-Biphenyl]-3-acetic acid, 2'-chloro-

(2′-Chloro-biphenyl-3-yl)-acetic acid

CAS: 669713-78-4

Formula: C₁₄H₁₁ClO₂

Purity: 97.0%

Molecular weight: 246.69

Ref: 10-F011474