CAS 669713-79-5

(3',5'-dichlorobiphenyl-2-yl)acetic acid

Description:

(3',5'-Dichlorobiphenyl-2-yl)acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine substituents at the 3' and 5' positions on one of the phenyl rings contributes to its chemical properties, including increased hydrophobicity and potential biological activity. The acetic acid functional group (-COOH) attached to the biphenyl structure imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound may exhibit specific interactions with biological systems, making it of interest in environmental chemistry and toxicology, particularly regarding its persistence and potential effects on ecosystems. Its molecular structure suggests that it may have applications in the synthesis of other chemical compounds or materials. As with many chlorinated compounds, it is essential to consider its environmental impact and regulatory status due to potential toxicity and bioaccumulation.

Formula: C₁₄H₁₀Cl₂O₂

InChI: InChI=1/C14H10Cl2O2/c15-11-5-10(6-12(16)8-11)13-4-2-1-3-9(13)7-14(17)18/h1-6,8H,7H2,(H,17,18)

SMILES: c1ccc(c(c1)CC(=O)O)c1cc(cc(c1)Cl)Cl

Synonyms:

• [1,1'-Biphenyl]-2-acetic acid, 3',5'-dichloro-
• (3',5'-Dichlorobiphenyl-2-yl)acetic acid
• 2-(3',5'-Dichloro-[1,1'-biphenyl]-2-yl)aceticacid
• 3',5'-Dichloro-biphenyl-2-acetic acid
• 3',5'-Dichloro[1,1'-biphenyl]-2-acetic acid

(3′,5′-Dichloro-biphenyl-2-yl)-acetic acid

CAS: 669713-79-5

Formula: C₁₄H₁₀Cl₂O₂

Purity: 97.0%

Molecular weight: 281.13

Ref: 10-F011477