CAS 669713-90-0

(4'-formylbiphenyl-4-yl)acetic acid

Description:

(4'-formylbiphenyl-4-yl)acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a formyl group (-CHO) at the para position of one of the phenyl rings and a carboxylic acid group (-COOH) at the acetic acid moiety contributes to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit both polar and nonpolar characteristics due to the combination of functional groups, influencing its solubility in various solvents. It may participate in various chemical reactions, such as condensation and esterification, making it useful in the synthesis of more complex organic molecules. Additionally, the presence of the formyl group suggests potential for further functionalization, which can be exploited in medicinal chemistry or materials science. As with many organic compounds, safety precautions should be taken when handling it, and its stability under different conditions should be evaluated for specific applications.

Formula: C₁₅H₁₂O₃

InChI: InChI=1/C15H12O3/c16-10-12-3-7-14(8-4-12)13-5-1-11(2-6-13)9-15(17)18/h1-8,10H,9H2,(H,17,18)

SMILES: c1cc(ccc1CC(=O)O)c1ccc(cc1)C=O

Synonyms:

• [1,1'-Biphenyl]-4-acetic acid, 4'-formyl-
• (4'-Formylbiphenyl-4-yl)acetic acid

(4′-Formyl-biphenyl-4-yl)-acetic acid

CAS: 669713-90-0

Formula: C₁₅H₁₂O₃

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 240.258

Ref: 10-F011500