CymitQuimica logo

CAS 669713-92-2

:

3-Chloro-α-[[(1,1-dimethylethoxy)carbonyl]amino]benzeneacetic acid

Description:
3-Chloro-α-[[(1,1-dimethylethoxy)carbonyl]amino]benzeneacetic acid, with CAS number 669713-92-2, is a synthetic organic compound characterized by its complex structure, which includes a chloro substituent, an amino group, and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its benzene ring and acetic acid moiety. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it may have protective or stabilizing characteristics, which can influence its reactivity and solubility in various solvents. The chloro group can enhance the compound's electrophilicity, making it potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the amino group may impart basicity, allowing for interactions with acids or other electrophiles. Overall, this compound's unique functional groups and structural features make it of interest in medicinal chemistry and synthetic organic chemistry, where it may serve as an intermediate or a building block for more complex molecules.
Formula:C13H16ClNO4
InChI:InChI=1S/C13H16ClNO4/c1-13(2,3)19-12(18)15-10(11(16)17)8-5-4-6-9(14)7-8/h4-7,10H,1-3H3,(H,15,18)(H,16,17)
InChI key:InChIKey=BGMKFLAFNZFBBB-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)(C(O)=O)C1=CC(Cl)=CC=C1
Synonyms:
  • 2-[[(tert-Butoxy)carbonyl]amino]-2-(3-chlorophenyl)acetic acid
  • 3-Chloro-α-[[(1,1-dimethylethoxy)carbonyl]amino]benzeneacetic acid
  • Benzeneacetic acid, 3-chloro-alpha-[[(1,1-dimethylethoxy)carbonyl]amino]-
  • Benzeneacetic acid, 3-chloro-α-[[(1,1-dimethylethoxy)carbonyl]amino]-
  • N-Boc-(3'-Chlorophenyl)glycine
  • [(tert-Butoxycarbonyl)amino](3-chlorophenyl)acetic acid
Found 5 products.