CAS 669726-50-5

5-[1-(3,4-dimethylphenoxy)ethyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(3,4-dimethylphenoxy)ethyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 669726-50-5, is a chemical compound characterized by its unique triazole structure, which incorporates a thione functional group. This compound features a substituted phenoxy group, contributing to its potential biological activity. The presence of the prop-2-en-1-yl group indicates that it has an alkene functionality, which may enhance its reactivity and interactions in various chemical environments. The triazole ring is known for its stability and is often found in pharmaceuticals and agrochemicals due to its ability to form hydrogen bonds and participate in coordination chemistry. The compound's thione group may impart specific properties related to its reactivity and potential applications in medicinal chemistry. Overall, this compound's structural features suggest it may exhibit interesting pharmacological properties, making it a subject of interest for further research in drug development and agricultural applications.

Formula: C₁₅H₁₉N₃OS

InChI: InChI=1/C15H19N3OS/c1-5-8-18-14(16-17-15(18)20)12(4)19-13-7-6-10(2)11(3)9-13/h5-7,9,12H,1,8H2,2-4H3,(H,17,20)

SMILES: C=CCn1c(C(C)Oc2ccc(C)c(C)c2)nnc1S

Synonyms:

• 4-Allyl-5-[1-(3,4-dimethylphenoxy)ethyl]-4H-1,2,4-triazole-3-thiol
• 4H-1,2,4-triazole-3-thiol, 5-[1-(3,4-dimethylphenoxy)ethyl]-4-(2-propen-1-yl)-

4-allyl-5-[1-(3,4-dimethylphenoxy)ethyl]-4H-1,2,4-triazole-3-thiol

CAS: 669726-50-5

Formula: C₁₅H₁₉N₃OS

Purity: 95.0%

Molecular weight: 289.4

Ref: 10-F307802